[2,6,6,9-Tetramethyl-5-(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] 2-methylbut-2-enoate
| Internal ID | 0ce81446-e59b-4a24-a621-04c6fa904613 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | [2,6,6,9-tetramethyl-5-(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] 2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1CC2(C3C(C2C(=O)C=C3C)C(C1OC(=O)C(=CC)C)(C)C)C |
| SMILES (Isomeric) | CC=C(C)C(=O)OC1CC2(C3C(C2C(=O)C=C3C)C(C1OC(=O)C(=CC)C)(C)C)C |
| InChI | InChI=1S/C25H34O5/c1-9-13(3)22(27)29-17-12-25(8)18-15(5)11-16(26)19(25)20(18)24(6,7)21(17)30-23(28)14(4)10-2/h9-11,17-21H,12H2,1-8H3 |
| InChI Key | BIVCQGLUAJLXHM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.24062418 g/mol |
| Topological Polar Surface Area (TPSA) | 69.70 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of [2,6,6,9-Tetramethyl-5-(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] 2-methylbut-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/a6b23460-85c7-11ee-82bd-1de4465431ea.jpg "2D Structure of [2,6,6,9-Tetramethyl-5-(2-methylbut-2-enoyloxy)-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] 2-methylbut-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.63% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.70% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.28% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.27% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.05% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.33% | 90.17% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.48% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.44% | 86.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.07% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.03% | 99.23% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.29% | 91.07% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.77% | 90.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.74% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.15% | 95.89% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.37% | 97.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.19% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Stevia pilosa |
| Stevia serrata |
| PubChem | 163064356 |
| LOTUS | LTS0074836 |
| wikiData | Q104936816 |