[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (1S,2R,5R,6S,8R,9R,14S,18R,19R,21S,24R)-8-hydroxy-1-(hydroxymethyl)-5,6,12,12,19-pentamethyl-23-oxo-24-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-15-ene-9-carboxylate
Internal ID | d8237c45-1bac-4ecd-9004-97b4e7e4c9ce |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (1S,2R,5R,6S,8R,9R,14S,18R,19R,21S,24R)-8-hydroxy-1-(hydroxymethyl)-5,6,12,12,19-pentamethyl-23-oxo-24-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-15-ene-9-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC(=O)C34CCC(CC3C5=CCC6C(C5(CC4O)C)(CCC7C6(CC8C(C7(C(=O)O8)CO)OC9C(C(C(C(O9)CO)O)O)O)C)C)(C)C)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@H](CO[C@H]2OC(=O)[C@]34CCC(C[C@H]3C5=CC[C@H]6[C@]([C@@]5(C[C@H]4O)C)(CC[C@@H]7[C@@]6(C[C@H]8[C@@H]([C@@]7(C(=O)O8)CO)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)C)C)(C)C)O)O)O)O)O |
InChI | InChI=1S/C47H72O20/c1-19-28(52)31(55)33(57)37(62-19)65-35-29(53)22(50)17-61-39(35)67-40(59)46-12-11-42(2,3)13-21(46)20-7-8-25-43(4)14-23-36(66-38-34(58)32(56)30(54)24(16-48)63-38)47(18-49,41(60)64-23)26(43)9-10-44(25,5)45(20,6)15-27(46)51/h7,19,21-39,48-58H,8-18H2,1-6H3/t19-,21-,22-,23-,24+,25+,26+,27+,28-,29-,30+,31+,32-,33+,34+,35+,36-,37-,38-,39-,43+,44+,45+,46+,47+/m0/s1 |
InChI Key | AMFATATVKIIQQF-BWBRNKLZSA-N |
Popularity | 0 references in papers |
Molecular Formula | C47H72O20 |
Molecular Weight | 957.10 g/mol |
Exact Mass | 956.46169468 g/mol |
Topological Polar Surface Area (TPSA) | 321.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (1S,2R,5R,6S,8R,9R,14S,18R,19R,21S,24R)-8-hydroxy-1-(hydroxymethyl)-5,6,12,12,19-pentamethyl-23-oxo-24-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-15-ene-9-carboxylate 2D Structure of [(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl] (1S,2R,5R,6S,8R,9R,14S,18R,19R,21S,24R)-8-hydroxy-1-(hydroxymethyl)-5,6,12,12,19-pentamethyl-23-oxo-24-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-22-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-15-ene-9-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/a649a6d0-86ad-11ee-a564-d96167150274.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.25% | 97.25% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.56% | 97.36% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.92% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.72% | 96.61% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.48% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.23% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.27% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.26% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.24% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.98% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.96% | 94.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.23% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.84% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.45% | 95.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.19% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.30% | 86.92% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.21% | 91.07% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.58% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.55% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 81.92% | 97.50% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.24% | 94.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.06% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Platycodon grandiflorus |
PubChem | 101403596 |
LOTUS | LTS0131533 |
wikiData | Q104914587 |