[(2S)-2-[8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoyloxy]-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoate
Internal ID | b74c85be-f24e-4a84-9738-a20c0e9cb14a |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
IUPAC Name | [(2S)-2-[8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoyloxy]-3-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] 8-[(1S,5S)-4-oxo-5-[(Z)-pent-2-enyl]cyclopent-2-en-1-yl]octanoate |
SMILES (Canonical) | CCC=CCC1C(C=CC1=O)CCCCCCCC(=O)OCC(COC2C(C(C(C(O2)CO)O)O)O)OC(=O)CCCCCCCC3C=CC(=O)C3CC=CCC |
SMILES (Isomeric) | CC/C=C\C[C@H]1[C@H](C=CC1=O)CCCCCCCC(=O)OC[C@H](CO[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)OC(=O)CCCCCCC[C@H]3C=CC(=O)[C@H]3C/C=C\CC |
InChI | InChI=1S/C45H70O12/c1-3-5-13-21-35-32(25-27-37(35)47)19-15-9-7-11-17-23-40(49)54-30-34(31-55-45-44(53)43(52)42(51)39(29-46)57-45)56-41(50)24-18-12-8-10-16-20-33-26-28-38(48)36(33)22-14-6-4-2/h5-6,13-14,25-28,32-36,39,42-46,51-53H,3-4,7-12,15-24,29-31H2,1-2H3/b13-5-,14-6-/t32-,33-,34+,35-,36-,39+,42-,43-,44+,45+/m0/s1 |
InChI Key | SYJOSMLJXIQXFJ-YENLXDNHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H70O12 |
Molecular Weight | 803.00 g/mol |
Exact Mass | 802.48672766 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 7.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.95% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.86% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.71% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 94.69% | 98.95% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.73% | 92.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.15% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.04% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.41% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.87% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.18% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.39% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.74% | 97.09% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.02% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 162911818 |
LOTUS | LTS0223600 |
wikiData | Q105263607 |