(1R,4aR,7aR)-7-[[(E,6R)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid
Internal ID | 06bfa5ed-d38b-4137-8a55-a6efd69b5661 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Iridoids and derivatives |
IUPAC Name | (1R,4aR,7aR)-7-[[(E,6R)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC(CCC=C(C)C(=O)OCC1=CCC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)OC)O)O)O)CCO |
SMILES (Isomeric) | C[C@H](CC/C=C(\C)/C(=O)OCC1=CC[C@@H]2[C@H]1[C@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)OC)O)O)O)CCO |
InChI | InChI=1S/C26H38O12/c1-13(9-10-27)5-4-6-14(2)23(33)35-11-15-7-8-16-17(22(31)32)12-36-24(18(15)16)37-26-21(30)19(28)20(29)25(34-3)38-26/h6-7,12-13,16,18-21,24-30H,4-5,8-11H2,1-3H3,(H,31,32)/b14-6+/t13-,16+,18+,19+,20+,21-,24-,25+,26-/m1/s1 |
InChI Key | NQPIYCYOLSTBTM-YHQPQHOQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H38O12 |
Molecular Weight | 542.60 g/mol |
Exact Mass | 542.23632664 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | 0.10 |
There are no found synonyms. |
![2D Structure of (1R,4aR,7aR)-7-[[(E,6R)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid 2D Structure of (1R,4aR,7aR)-7-[[(E,6R)-8-hydroxy-2,6-dimethyloct-2-enoyl]oxymethyl]-1-[(2R,3R,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/a55b3e10-8542-11ee-9864-33a961ccdbf1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.36% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.56% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.65% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.55% | 97.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.58% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.56% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.47% | 98.95% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.60% | 94.08% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.27% | 93.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.84% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.46% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.78% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.94% | 99.23% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.63% | 96.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.44% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Scyphiphora hydrophylacea |
PubChem | 163033585 |
LOTUS | LTS0153785 |
wikiData | Q105184020 |