2-[[1-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxane-3,4,5-triol
Internal ID | a5c4ac0d-ec26-44d4-b47d-fa8afd349271 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | 2-[[1-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CC(C5(C4CCC3(C2C(C)C(CCC(C)C)O)C)C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)C)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CC(C5(C4CCC3(C2C(C)C(CCC(C)C)O)C)C)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)C)O)O)O)O)O)O)O |
InChI | InChI=1S/C45H76O17/c1-18(2)8-11-27(48)19(3)31-28(59-41-38(55)35(52)32(49)20(4)57-41)16-26-24-10-9-22-14-23(47)15-30(45(22,7)25(24)12-13-44(26,31)6)61-43-40(37(54)34(51)29(17-46)60-43)62-42-39(56)36(53)33(50)21(5)58-42/h9,18-21,23-43,46-56H,8,10-17H2,1-7H3 |
InChI Key | DQTJHUAYAXNSLA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H76O17 |
Molecular Weight | 889.10 g/mol |
Exact Mass | 888.50825095 g/mol |
Topological Polar Surface Area (TPSA) | 278.00 Ų |
XlogP | 0.90 |
There are no found synonyms. |
![2D Structure of 2-[[1-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxane-3,4,5-triol 2D Structure of 2-[[1-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-3-hydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/a554dfa0-86b1-11ee-b1f6-03d32bd42317.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL226 | P30542 | Adenosine A1 receptor | 99.02% | 95.93% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.84% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.04% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.44% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.25% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 94.23% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.31% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.01% | 89.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 91.80% | 98.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.28% | 86.33% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.23% | 93.56% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.13% | 95.58% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.56% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.56% | 97.36% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.18% | 100.00% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 86.75% | 94.50% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.28% | 90.17% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 85.47% | 97.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.30% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.04% | 94.73% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.87% | 98.10% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.20% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.07% | 95.89% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.33% | 96.31% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.90% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.64% | 96.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 81.06% | 97.79% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.75% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Beaucarnea recurvata |
PubChem | 85118482 |
LOTUS | LTS0039023 |
wikiData | Q104987137 |