[(2R,3R,4aR,6aR,6bS,8aR,11R,12R,12aR,14aR,14bR)-2,3-diacetyloxy-4-(acetyloxymethyl)-12-hydroxy-6a,6b,8a,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,11,12a,14,14a-tetradecahydropicen-4-yl]methyl acetate
| Internal ID | a566572b-3985-4b50-a5c2-c587cc3b2d9a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | [(2R,3R,4aR,6aR,6bS,8aR,11R,12R,12aR,14aR,14bR)-2,3-diacetyloxy-4-(acetyloxymethyl)-12-hydroxy-6a,6b,8a,11,12,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,11,12a,14,14a-tetradecahydropicen-4-yl]methyl acetate |
| SMILES (Canonical) | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(COC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C)C)C2C1(C)O)C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(COC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C)C)[C@@H]2[C@]1(C)O)C)C |
| InChI | InChI=1S/C38H58O9/c1-22-13-15-33(6)17-18-35(8)27(31(33)37(22,10)43)11-12-29-34(7)19-28(46-25(4)41)32(47-26(5)42)38(20-44-23(2)39,21-45-24(3)40)30(34)14-16-36(29,35)9/h11,22,28-32,43H,12-21H2,1-10H3/t22-,28-,29-,30-,31+,32+,33-,34-,35-,36-,37-/m1/s1 |
| InChI Key | MWTMFRDDMNGKJJ-FTSPISAHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C38H58O9 |
| Molecular Weight | 658.90 g/mol |
| Exact Mass | 658.40808342 g/mol |
| Topological Polar Surface Area (TPSA) | 125.00 Ų |
| XlogP | 6.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.88% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.14% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.36% | 94.45% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.30% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.95% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.24% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.13% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.40% | 97.09% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.66% | 93.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.11% | 95.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.08% | 91.19% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.96% | 96.77% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.76% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.20% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.64% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.52% | 94.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.03% | 95.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.54% | 91.07% |
| CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 81.09% | 91.65% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.01% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Rudgea viburnoides |
| PubChem | 162851148 |
| LOTUS | LTS0081956 |
| wikiData | Q105173801 |