[5-[5-Hydroxy-6-methyl-4-(2-methylpropanoyloxy)-3-(3-phenylprop-2-enoyloxy)oxan-2-yl]oxy-6-methyl-2-[(4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl)oxy]-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 2-methylbutanoate
Internal ID | b19a882b-84b4-4611-b7e1-0e7637ec0d3f |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [5-[5-hydroxy-6-methyl-4-(2-methylpropanoyloxy)-3-(3-phenylprop-2-enoyloxy)oxan-2-yl]oxy-6-methyl-2-[(4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl)oxy]-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl] 2-methylbutanoate |
SMILES (Canonical) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)OC(=O)C(C)C)OC(=O)C=CC5=CC=CC=C5)OC6C(C(C(C(O6)C)O)O)O)OC(=O)C(C)CC)C)OC7C(C(C(OC7O1)C)O)O)O |
SMILES (Isomeric) | CCCCCC1CCCCCCCCCC(=O)OC2C(C(OC(C2OC3C(C(C(C(O3)C)OC4C(C(C(C(O4)C)O)OC(=O)C(C)C)OC(=O)C=CC5=CC=CC=C5)OC6C(C(C(C(O6)C)O)O)O)OC(=O)C(C)CC)C)OC7C(C(C(OC7O1)C)O)O)O |
InChI | InChI=1S/C64H100O25/c1-11-13-20-27-40-28-23-17-15-14-16-18-24-29-41(65)82-53-49(73)61(88-54-47(71)44(68)35(7)77-62(54)81-40)79-37(9)50(53)86-64-57(85-59(75)33(5)12-2)55(89-60-48(72)46(70)43(67)34(6)76-60)51(38(10)80-64)87-63-56(83-42(66)31-30-39-25-21-19-22-26-39)52(45(69)36(8)78-63)84-58(74)32(3)4/h19,21-22,25-26,30-38,40,43-57,60-64,67-73H,11-18,20,23-24,27-29H2,1-10H3 |
InChI Key | SNEDYVMYDFOKJF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C64H100O25 |
Molecular Weight | 1269.50 g/mol |
Exact Mass | 1268.65536867 g/mol |
Topological Polar Surface Area (TPSA) | 339.00 Ų |
XlogP | 6.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.48% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.84% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.89% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.13% | 96.09% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.95% | 83.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.56% | 96.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 94.33% | 92.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.90% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.47% | 93.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.66% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.35% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.00% | 96.47% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.66% | 91.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.52% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.42% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.01% | 95.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.38% | 97.36% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.81% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.37% | 95.89% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.19% | 96.37% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.71% | 90.71% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 82.61% | 96.25% |
CHEMBL5028 | O14672 | ADAM10 | 82.27% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.83% | 93.00% |
CHEMBL5957 | P21589 | 5'-nucleotidase | 80.56% | 97.78% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.11% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea batatas |
PubChem | 74336637 |
LOTUS | LTS0160791 |
wikiData | Q105256366 |