(3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]oxolan-2-one
Internal ID | aa40e54d-95bc-4b78-ae70-db00977a18e5 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]oxolan-2-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)CC2COC(=O)C2(CC3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C[C@@H]2COC(=O)[C@]2(CC3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)O)OC |
InChI | InChI=1S/C27H34O12/c1-34-17-6-4-14(9-19(17)35-2)8-16-13-37-26(32)27(16,33)11-15-5-7-18(20(10-15)36-3)38-25-24(31)23(30)22(29)21(12-28)39-25/h4-7,9-10,16,21-25,28-31,33H,8,11-13H2,1-3H3/t16-,21-,22-,23+,24-,25-,27-/m1/s1 |
InChI Key | LWYAMIUSVGPFKS-JUXBYTHFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H34O12 |
Molecular Weight | 550.60 g/mol |
Exact Mass | 550.20502652 g/mol |
Topological Polar Surface Area (TPSA) | 174.00 Ų |
XlogP | 1.00 |
There are no found synonyms. |
![2D Structure of (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]oxolan-2-one 2D Structure of (3R,4R)-4-[(3,4-dimethoxyphenyl)methyl]-3-hydroxy-3-[[3-methoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]oxolan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/a4d49b60-858c-11ee-8335-b5a73ceefcaf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.59% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.94% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.21% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.83% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.49% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.20% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.08% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.51% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.95% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.74% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.35% | 89.00% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 85.02% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.20% | 97.09% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.48% | 95.83% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.32% | 97.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.04% | 97.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.45% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.75% | 96.61% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.71% | 97.25% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.14% | 96.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 80.16% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Saussurea japonica |
PubChem | 10602740 |
LOTUS | LTS0052861 |
wikiData | Q105158656 |