2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,4,7-triol
Internal ID | 2c2a2d32-ee49-4c34-9a9f-9425f4560236 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,4,7-triol |
SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(C3=C(O2)C=C(C=C3)O)C4=CC5=C(C=C4O)OC(C(C5O)O)C6=CC(=C(C=C6)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2C(C(C3=C(O2)C=C(C=C3)O)C4=CC5=C(C=C4O)OC(C(C5O)O)C6=CC(=C(C=C6)O)O)O)O)O |
InChI | InChI=1S/C30H26O11/c31-14-3-4-15-23(9-14)40-29(12-1-5-18(32)21(35)7-12)27(38)25(15)16-10-17-24(11-20(16)34)41-30(28(39)26(17)37)13-2-6-19(33)22(36)8-13/h1-11,25-39H |
InChI Key | CLPJKIKSHFLLGR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H26O11 |
Molecular Weight | 562.50 g/mol |
Exact Mass | 562.14751164 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
![2D Structure of 2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,4,7-triol 2D Structure of 2-(3,4-dihydroxyphenyl)-6-[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-4-yl]-3,4-dihydro-2H-chromene-3,4,7-triol](https://plantaedb.com/storage/docs/compounds/2023/11/a4b94bb0-851c-11ee-8458-03ad6e32df43.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.58% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.04% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.81% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.21% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.92% | 83.82% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.98% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.35% | 95.56% |
CHEMBL2535 | P11166 | Glucose transporter | 85.47% | 98.75% |
CHEMBL2581 | P07339 | Cathepsin D | 85.24% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 85.18% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.03% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.73% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.50% | 85.14% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.58% | 100.00% |
CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 80.32% | 96.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Acacia fasciculifera |
PubChem | 12308746 |
LOTUS | LTS0071052 |
wikiData | Q104963778 |