(1R,2R,4aR,8aR)-2,4a,5-trimethyl-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalene-1-carbaldehyde
Internal ID | 399a4363-f209-4cf7-be66-14df604b4e90 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (1R,2R,4aR,8aR)-2,4a,5-trimethyl-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
SMILES (Canonical) | CC1CCC2(C(C1(CCC3=CCOC3=O)C=O)CCC=C2C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@]1(CCC3=CCOC3=O)C=O)CCC=C2C)C |
InChI | InChI=1S/C20H28O3/c1-14-5-4-6-17-19(14,3)10-7-15(2)20(17,13-21)11-8-16-9-12-23-18(16)22/h5,9,13,15,17H,4,6-8,10-12H2,1-3H3/t15-,17-,19+,20-/m1/s1 |
InChI Key | GVGYHBDXFYNVMA-WSTLGDPDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O3 |
Molecular Weight | 316.40 g/mol |
Exact Mass | 316.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 4.00 |
There are no found synonyms. |
![2D Structure of (1R,2R,4aR,8aR)-2,4a,5-trimethyl-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalene-1-carbaldehyde 2D Structure of (1R,2R,4aR,8aR)-2,4a,5-trimethyl-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-2,3,4,7,8,8a-hexahydronaphthalene-1-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/a4b57070-84f9-11ee-9734-9967f9e58a19.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.52% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.71% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.57% | 91.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 92.26% | 94.80% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.17% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.64% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.80% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.74% | 100.00% |
CHEMBL4072 | P07858 | Cathepsin B | 87.04% | 93.67% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.27% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.26% | 86.33% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 85.21% | 86.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.72% | 96.09% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.08% | 83.57% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.62% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solidago nemoralis |
PubChem | 163006417 |
LOTUS | LTS0134176 |
wikiData | Q105021215 |