[2-[2,5-Bis(acetyloxymethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-(5-methylhexanoyloxy)oxan-3-yl] 5-methylheptanoate
Internal ID | 536858e9-deb0-40b3-9450-9a4558c57769 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [2-[2,5-bis(acetyloxymethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-(5-methylhexanoyloxy)oxan-3-yl] 5-methylheptanoate |
SMILES (Canonical) | CCC(C)CCCC(=O)OC1C(C(C(OC1OC2(C(C(C(O2)COC(=O)C)O)O)COC(=O)C)CO)O)OC(=O)CCCC(C)C |
SMILES (Isomeric) | CCC(C)CCCC(=O)OC1C(C(C(OC1OC2(C(C(C(O2)COC(=O)C)O)O)COC(=O)C)CO)O)OC(=O)CCCC(C)C |
InChI | InChI=1S/C31H52O15/c1-7-18(4)11-9-13-24(36)44-28-27(43-23(35)12-8-10-17(2)3)25(37)21(14-32)42-30(28)46-31(16-41-20(6)34)29(39)26(38)22(45-31)15-40-19(5)33/h17-18,21-22,25-30,32,37-39H,7-16H2,1-6H3 |
InChI Key | JPADWXDVXFLVFE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H52O15 |
Molecular Weight | 664.70 g/mol |
Exact Mass | 664.33062095 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
![2D Structure of [2-[2,5-Bis(acetyloxymethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-(5-methylhexanoyloxy)oxan-3-yl] 5-methylheptanoate 2D Structure of [2-[2,5-Bis(acetyloxymethyl)-3,4-dihydroxyoxolan-2-yl]oxy-5-hydroxy-6-(hydroxymethyl)-4-(5-methylhexanoyloxy)oxan-3-yl] 5-methylheptanoate](https://plantaedb.com/storage/docs/compounds/2023/11/a429a430-85fa-11ee-8da8-27ea204dc500.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.53% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.95% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 95.14% | 98.95% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.03% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.14% | 97.25% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 92.61% | 82.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.18% | 92.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.13% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.91% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 90.47% | 96.61% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.47% | 99.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.96% | 97.79% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.55% | 96.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.97% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.11% | 93.56% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.48% | 91.19% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.73% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.08% | 97.21% |
CHEMBL299 | P17252 | Protein kinase C alpha | 83.95% | 98.03% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.11% | 96.90% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.99% | 85.14% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 82.07% | 92.32% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.80% | 100.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.63% | 94.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.55% | 97.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.50% | 92.86% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.45% | 94.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.36% | 98.10% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.48% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.38% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Nicotiana gossei |
PubChem | 162981096 |
LOTUS | LTS0108750 |
wikiData | Q105132622 |