8,9-dihydroxy-2-methoxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-anthracen-1-one
| Internal ID | bfaaa17d-4a22-4147-bd92-4477f43e7cb3 |
| Taxonomy | Benzenoids > Anthracenes |
| IUPAC Name | 8,9-dihydroxy-2-methoxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-anthracen-1-one |
| SMILES (Canonical) | CC1=CC2=CC3=C(C(=O)C(CC3OC4C(C(C(C(O4)CO)O)O)O)OC)C(=C2C(=C1)O)O |
| SMILES (Isomeric) | CC1=CC2=CC3=C(C(=O)C(CC3OC4C(C(C(C(O4)CO)O)O)O)OC)C(=C2C(=C1)O)O |
| InChI | InChI=1S/C22H26O10/c1-8-3-9-5-10-12(31-22-21(29)20(28)18(26)14(7-23)32-22)6-13(30-2)17(25)16(10)19(27)15(9)11(24)4-8/h3-5,12-14,18,20-24,26-29H,6-7H2,1-2H3 |
| InChI Key | UQFRNBZYKXMJPL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H26O10 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.15259702 g/mol |
| Topological Polar Surface Area (TPSA) | 166.00 Ų |
| XlogP | 0.80 |
| Atomic LogP (AlogP) | 0.02 |
| H-Bond Acceptor | 10 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 4 |
| There are no found synonyms. |
![2D Structure of 8,9-dihydroxy-2-methoxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-anthracen-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/a40855b0-8632-11ee-80e6-51d34bfdb513.jpg "2D Structure of 8,9-dihydroxy-2-methoxy-6-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-anthracen-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6306 | 63.06% |
| Caco-2 | - | 0.8390 | 83.90% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.8143 | 81.43% |
| Subcellular localzation | Mitochondria | 0.5142 | 51.42% |
| OATP2B1 inhibitior | - | 0.7104 | 71.04% |
| OATP1B1 inhibitior | + | 0.8128 | 81.28% |
| OATP1B3 inhibitior | + | 0.9580 | 95.80% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.5845 | 58.45% |
| P-glycoprotein inhibitior | - | 0.7462 | 74.62% |
| P-glycoprotein substrate | - | 0.7711 | 77.11% |
| CYP3A4 substrate | + | 0.6388 | 63.88% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8595 | 85.95% |
| CYP3A4 inhibition | - | 0.8918 | 89.18% |
| CYP2C9 inhibition | - | 0.9396 | 93.96% |
| CYP2C19 inhibition | - | 0.9239 | 92.39% |
| CYP2D6 inhibition | - | 0.8955 | 89.55% |
| CYP1A2 inhibition | - | 0.6643 | 66.43% |
| CYP2C8 inhibition | - | 0.5828 | 58.28% |
| CYP inhibitory promiscuity | - | 0.7941 | 79.41% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 1.0000 | 100.00% |
| Carcinogenicity (trinary) | Non-required | 0.7647 | 76.47% |
| Eye corrosion | - | 0.9891 | 98.91% |
| Eye irritation | - | 0.9215 | 92.15% |
| Skin irritation | - | 0.8094 | 80.94% |
| Skin corrosion | - | 0.9608 | 96.08% |
| Ames mutagenesis | + | 0.5700 | 57.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.6102 | 61.02% |
| Micronuclear | + | 0.5233 | 52.33% |
| Hepatotoxicity | - | 0.5375 | 53.75% |
| skin sensitisation | - | 0.9199 | 91.99% |
| Respiratory toxicity | + | 0.5889 | 58.89% |
| Reproductive toxicity | + | 0.7667 | 76.67% |
| Mitochondrial toxicity | + | 0.5125 | 51.25% |
| Nephrotoxicity | + | 0.5126 | 51.26% |
| Acute Oral Toxicity (c) | III | 0.7074 | 70.74% |
| Estrogen receptor binding | + | 0.8110 | 81.10% |
| Androgen receptor binding | + | 0.6102 | 61.02% |
| Thyroid receptor binding | - | 0.5189 | 51.89% |
| Glucocorticoid receptor binding | + | 0.7282 | 72.82% |
| Aromatase binding | + | 0.6006 | 60.06% |
| PPAR gamma | + | 0.5554 | 55.54% |
| Honey bee toxicity | - | 0.7808 | 78.08% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
| Fish aquatic toxicity | + | 0.8485 | 84.85% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.54% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.18% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.38% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.33% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.23% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.32% | 95.56% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.65% | 92.68% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.35% | 97.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.11% | 96.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.09% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.82% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.72% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.75% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.43% | 94.45% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.33% | 93.18% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.80% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.66% | 86.33% |
| PubChem | 162998327 |
| LOTUS | LTS0101353 |
| wikiData | Q105277230 |