[2-[3,5-Dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-hydroxy-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-6-methyloxan-4-yl] 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 4401132d-e91e-4121-b6a0-950a32b1de94 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [2-[3,5-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-5-hydroxy-3-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-6-methyloxan-4-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)O)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C=CC6=CC=C(C=C6)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC=C(C=C4)O)O)OC(=O)C=CC5=CC=C(C=C5)O)OC(=O)C=CC6=CC=C(C=C6)O)O |
InChI | InChI=1S/C39H32O14/c1-20-33(46)37(52-30(44)16-6-21-2-10-24(40)11-3-21)38(53-31(45)17-7-22-4-12-25(41)13-5-22)39(49-20)50-27-18-28(43)32-29(19-27)51-36(35(48)34(32)47)23-8-14-26(42)15-9-23/h2-20,33,37-43,46,48H,1H3 |
InChI Key | MCRKSHUHZRIUDW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H32O14 |
Molecular Weight | 724.70 g/mol |
Exact Mass | 724.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 219.00 Ų |
XlogP | 5.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.81% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 99.02% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.49% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 96.02% | 98.95% |
CHEMBL3194 | P02766 | Transthyretin | 95.30% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 95.28% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.35% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.93% | 94.73% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 90.66% | 98.35% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.47% | 99.15% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.67% | 95.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.03% | 91.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.99% | 90.71% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.96% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.79% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.49% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.81% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.74% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.32% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.82% | 94.45% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.08% | 94.80% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.81% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.77% | 99.23% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 81.67% | 89.49% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.59% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.00% | 95.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.61% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetrapanax papyrifer |
PubChem | 73027643 |
LOTUS | LTS0151634 |
wikiData | Q105161391 |