5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,7-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy]chromen-4-one
Internal ID | 80f1279d-f738-4991-8838-4dfbde528105 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,7-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy]chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)OC5C(C(C(C(O5)COC6C(C(C(C(O6)C)O)O)O)O)O)O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=C(C4=O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O)O)O)O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C39H50O26/c1-9-20(43)26(49)30(53)36(59-9)57-7-17-23(46)28(51)32(55)38(63-17)61-12-5-13(40)19-16(6-12)62-34(11-3-14(41)22(45)15(42)4-11)35(25(19)48)65-39-33(56)29(52)24(47)18(64-39)8-58-37-31(54)27(50)21(44)10(2)60-37/h3-6,9-10,17-18,20-21,23-24,26-33,36-47,49-56H,7-8H2,1-2H3/t9-,10-,17+,18+,20-,21-,23+,24+,26+,27+,28-,29-,30+,31+,32+,33+,36+,37+,38+,39-/m0/s1 |
InChI Key | SLFUCYSXSNDGIW-OSHKTPJNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H50O26 |
Molecular Weight | 934.80 g/mol |
Exact Mass | 934.25903170 g/mol |
Topological Polar Surface Area (TPSA) | 424.00 Ų |
XlogP | -5.10 |
There are no found synonyms. |
![2D Structure of 5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,7-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy]chromen-4-one 2D Structure of 5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,7-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/a3f0c8f0-85a1-11ee-aa64-d7cb967917f0.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.75% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.16% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.15% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.55% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 96.02% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.01% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 94.37% | 95.64% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.54% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.54% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.52% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.94% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.06% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.89% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.88% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.97% | 95.56% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.48% | 80.33% |
CHEMBL3194 | P02766 | Transthyretin | 82.90% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.86% | 90.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.46% | 94.42% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.30% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ajuga integrifolia |
PubChem | 163015313 |
LOTUS | LTS0017741 |
wikiData | Q105255291 |