20,21,25-Trimethoxy-15-methyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaen-6-ol
Internal ID | 8b805eca-9ceb-4a68-a95b-90a12f5724de |
Taxonomy | Lignans, neolignans and related compounds |
IUPAC Name | 20,21,25-trimethoxy-15-methyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaen-6-ol |
SMILES (Canonical) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6)OC)O3)O)OC)OC |
SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C2C1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)CC6C7=CC(=C(C=C7CCN6)OC)O3)O)OC)OC |
InChI | InChI=1S/C36H38N2O6/c1-38-14-12-24-19-33(41-3)35(42-4)36-34(24)28(38)16-21-5-8-25(9-6-21)43-30-17-22(7-10-29(30)39)15-27-26-20-32(44-36)31(40-2)18-23(26)11-13-37-27/h5-10,17-20,27-28,37,39H,11-16H2,1-4H3 |
InChI Key | FFMSDFHGOKKUKH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H38N2O6 |
Molecular Weight | 594.70 g/mol |
Exact Mass | 594.27298694 g/mol |
Topological Polar Surface Area (TPSA) | 81.60 Ų |
XlogP | 5.90 |
There are no found synonyms. |
![2D Structure of 20,21,25-Trimethoxy-15-methyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaen-6-ol 2D Structure of 20,21,25-Trimethoxy-15-methyl-8,23-dioxa-15,30-diazaheptacyclo[22.6.2.29,12.13,7.114,18.027,31.022,33]hexatriaconta-3(36),4,6,9(35),10,12(34),18,20,22(33),24,26,31-dodecaen-6-ol](https://plantaedb.com/storage/docs/compounds/2023/11/a3aa2800-8450-11ee-a388-293feba461fd.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.47% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.60% | 93.99% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.31% | 91.11% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 95.23% | 91.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.97% | 94.45% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.69% | 95.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.74% | 85.14% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.76% | 91.03% |
CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 89.39% | 93.40% |
CHEMBL2535 | P11166 | Glucose transporter | 89.32% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.04% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.91% | 95.89% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 87.86% | 96.76% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.83% | 89.50% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.47% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.39% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.13% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.08% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.54% | 92.94% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.61% | 89.62% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 82.13% | 80.78% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.98% | 82.38% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.88% | 95.78% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.58% | 85.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.34% | 99.17% |
CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 80.71% | 90.95% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.53% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Garcinia hanburyi |
PubChem | 15558877 |
LOTUS | LTS0125789 |
wikiData | Q105147836 |