(1S,3R,7S,9S,12S,13R,15R)-13-hydroxy-3,7,12-trimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione
Internal ID | 888718d9-2763-43e5-a28e-af3902f8d8ea |
Taxonomy | Organoheterocyclic compounds > Furofurans |
IUPAC Name | (1S,3R,7S,9S,12S,13R,15R)-13-hydroxy-3,7,12-trimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione |
SMILES (Canonical) | CC1CC2C3C(CC4(C(=O)C=C1O4)C)OC(C3(C(=O)O2)C)(C(=C)C)O |
SMILES (Isomeric) | C[C@H]1C[C@H]2[C@H]3[C@H](C[C@@]4(C(=O)C=C1O4)C)O[C@@]([C@]3(C(=O)O2)C)(C(=C)C)O |
InChI | InChI=1S/C19H24O6/c1-9(2)19(22)18(5)15-12(23-16(18)21)6-10(3)11-7-14(20)17(4,24-11)8-13(15)25-19/h7,10,12-13,15,22H,1,6,8H2,2-5H3/t10-,12-,13-,15-,17+,18+,19+/m0/s1 |
InChI Key | QELCTFSESIMBGF-MHXDOCJMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O6 |
Molecular Weight | 348.40 g/mol |
Exact Mass | 348.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 82.10 Ų |
XlogP | 1.90 |
There are no found synonyms. |
![2D Structure of (1S,3R,7S,9S,12S,13R,15R)-13-hydroxy-3,7,12-trimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione 2D Structure of (1S,3R,7S,9S,12S,13R,15R)-13-hydroxy-3,7,12-trimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione](https://plantaedb.com/storage/docs/compounds/2023/11/a38746e0-8624-11ee-b845-27886884895b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.70% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.18% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.83% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.42% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.35% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.29% | 100.00% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 86.91% | 86.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.38% | 92.94% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.94% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.74% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.51% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.92% | 96.43% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.34% | 99.23% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.10% | 91.49% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.09% | 96.61% |
CHEMBL2581 | P07339 | Cathepsin D | 80.94% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Paralychnophora bicolor |
PubChem | 162963319 |
LOTUS | LTS0018725 |
wikiData | Q105219275 |