(1R,2R,5S,7R,8R,9S,10S,11R,18S)-7,9,10,18-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-16-one
Internal ID | 6177eae7-895b-4f07-a7f4-433076e2df10 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (1R,2R,5S,7R,8R,9S,10S,11R,18S)-7,9,10,18-tetrahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-16-one |
SMILES (Canonical) | CC1(CCCC23C1C(C(C45C2CCC(C4O)C(=C)C5O)(OC3=O)O)O)C |
SMILES (Isomeric) | CC1(CCC[C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2CC[C@H]([C@@H]4O)C(=C)[C@H]5O)(OC3=O)O)O)C |
InChI | InChI=1S/C20H28O6/c1-9-10-5-6-11-18-8-4-7-17(2,3)12(18)15(23)20(25,26-16(18)24)19(11,13(9)21)14(10)22/h10-15,21-23,25H,1,4-8H2,2-3H3/t10-,11-,12+,13+,14-,15-,18+,19-,20+/m0/s1 |
InChI Key | DWBNAAUVBIEEOE-RMUPGQIJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H28O6 |
Molecular Weight | 364.40 g/mol |
Exact Mass | 364.18858861 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.58% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.53% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.33% | 97.25% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.38% | 83.57% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 87.09% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.06% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.38% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.34% | 97.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.13% | 96.61% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.97% | 95.89% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.60% | 96.43% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.01% | 100.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.89% | 97.05% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.86% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.74% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.66% | 94.45% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.45% | 93.03% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 80.26% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 163015914 |
LOTUS | LTS0073514 |
wikiData | Q104990469 |