2-(2,4-Dihydroxyphenyl)-3-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)pyrano[2,3-h]chromen-4-one
| Internal ID | 83e67abf-9296-402e-b592-e70f1da4eab4 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 6-prenylated flavones |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-3-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)pyrano[2,3-h]chromen-4-one |
| SMILES (Canonical) | CC(=CCCC(=CCC1=C(OC2=C3C=CC(OC3=C(C(=C2C1=O)O)CC=C(C)C)(C)C)C4=C(C=C(C=C4)O)O)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CCC1=C(OC2=C3C=CC(OC3=C(C(=C2C1=O)O)CC=C(C)C)(C)C)C4=C(C=C(C=C4)O)O)C)C |
| InChI | InChI=1S/C35H40O6/c1-20(2)9-8-10-22(5)12-15-25-30(38)29-31(39)26(14-11-21(3)4)33-27(17-18-35(6,7)41-33)34(29)40-32(25)24-16-13-23(36)19-28(24)37/h9,11-13,16-19,36-37,39H,8,10,14-15H2,1-7H3 |
| InChI Key | MXUVULSNGAUYDB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H40O6 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.28248899 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 9.30 |
| There are no found synonyms. |
![2D Structure of 2-(2,4-Dihydroxyphenyl)-3-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)pyrano[2,3-h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/a3192610-8618-11ee-a387-21dbfd9a8923.jpg "2D Structure of 2-(2,4-Dihydroxyphenyl)-3-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)pyrano[2,3-h]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.37% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.41% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.04% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.92% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.85% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.53% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.98% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.77% | 99.17% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.75% | 93.10% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.35% | 98.35% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.25% | 90.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.01% | 95.56% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 86.28% | 80.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.20% | 90.00% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.61% | 91.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.99% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.85% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.26% | 95.89% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.90% | 85.30% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.78% | 96.12% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.58% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.39% | 98.75% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.29% | 97.28% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artocarpus altilis |
| PubChem | 78200897 |
| LOTUS | LTS0229219 |
| wikiData | Q105174629 |