streptovirudin B2
| Internal ID | 4ec2eb8d-934f-44bc-b939-c653c6aa9b42 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Aminosaccharides > N-acyl-alpha-hexosamines |
| IUPAC Name | (E,10S)-N-[(2R,3R,4S,5R,6S)-2-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R)-2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-4,5-dihydroxyoxan-3-yl]-10-methyldodec-2-enamide |
| SMILES (Canonical) | CCC(C)CCCCCCC=CC(=O)NC1C(C(C(OC1OC2C(C(C(C(O2)CO)O)O)NC(=O)C)CC(C3C(C(C(O3)N4C=CC(=O)NC4=O)O)O)O)O)O |
| SMILES (Isomeric) | CC[C@H](C)CCCCCC/C=C/C(=O)N[C@@H]1[C@@H]([C@H]([C@@H](O[C@@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)NC(=O)C)C[C@H]([C@@H]3[C@@H]([C@@H]([C@@H](O3)N4C=CC(=O)NC4=O)O)O)O)O)O |
| InChI | InChI=1S/C36H58N4O16/c1-4-17(2)11-9-7-5-6-8-10-12-22(44)38-25-29(49)26(46)20(53-35(25)56-34-24(37-18(3)42)28(48)27(47)21(16-41)54-34)15-19(43)32-30(50)31(51)33(55-32)40-14-13-23(45)39-36(40)52/h10,12-14,17,19-21,24-35,41,43,46-51H,4-9,11,15-16H2,1-3H3,(H,37,42)(H,38,44)(H,39,45,52)/b12-10+/t17-,19+,20-,21+,24+,25+,26-,27+,28+,29-,30+,31-,32+,33+,34-,35+/m0/s1 |
| InChI Key | LLDGJSBCVXZHFQ-MYTQGMHKSA-N |
| Popularity | 14 references in papers |
| Molecular Formula | C36H58N4O16 |
| Molecular Weight | 802.90 g/mol |
| Exact Mass | 802.38478178 g/mol |
| Topological Polar Surface Area (TPSA) | 306.00 Ų |
| XlogP | -0.90 |
| RefChem:932281 |
| 51330-31-5 |
| CHEBI:223992 |
| (E,10S)-N-[(2R,3R,4S,5R,6S)-2-[(2S,3R,4R,5S,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R)-2-[(2R,3R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-4,5-dihydroxyoxan-3-yl]-10-methyldodec-2-enamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.21% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.47% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.33% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.37% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.59% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.60% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.12% | 89.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 91.88% | 98.59% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.70% | 93.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.86% | 95.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.85% | 94.66% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.78% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.76% | 96.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.48% | 94.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.04% | 95.89% |
| CHEMBL2123 | P51582 | Pyrimidinergic receptor P2Y4 | 85.69% | 93.39% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.01% | 90.71% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.96% | 95.83% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.57% | 94.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.16% | 92.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.02% | 95.93% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.73% | 89.62% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.37% | 95.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.22% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589181 |
| LOTUS | LTS0111851 |
| wikiData | Q105153423 |