Methyl 5,7-diacetyl-4-hydroxy-6-(8-hydroxy-7-methoxy-5-methoxycarbonyl-4-oxochromen-2-yl)-3-methoxy-9-oxoxanthene-1-carboxylate
| Internal ID | 4325f117-94fa-4f3d-90a2-1a520ec8605b |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | methyl 5,7-diacetyl-4-hydroxy-6-(8-hydroxy-7-methoxy-5-methoxycarbonyl-4-oxochromen-2-yl)-3-methoxy-9-oxoxanthene-1-carboxylate |
| SMILES (Canonical) | CC(=O)C1=C(C(=C2C(=C1)C(=O)C3=C(O2)C(=C(C=C3C(=O)OC)OC)O)C(=O)C)C4=CC(=O)C5=C(O4)C(=C(C=C5C(=O)OC)OC)O |
| SMILES (Isomeric) | CC(=O)C1=C(C(=C2C(=C1)C(=O)C3=C(O2)C(=C(C=C3C(=O)OC)OC)O)C(=O)C)C4=CC(=O)C5=C(O4)C(=C(C=C5C(=O)OC)OC)O |
| InChI | InChI=1S/C32H24O14/c1-11(33)13-7-16-25(36)24-15(32(40)44-6)9-20(42-4)27(38)30(24)46-28(16)21(12(2)34)23(13)18-10-17(35)22-14(31(39)43-5)8-19(41-3)26(37)29(22)45-18/h7-10,37-38H,1-6H3 |
| InChI Key | XWXMXQKIUMKPJQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C32H24O14 |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 632.11660544 g/mol |
| Topological Polar Surface Area (TPSA) | 198.00 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.75% | 85.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.69% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.91% | 94.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.85% | 94.42% |
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 89.87% | 98.21% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.73% | 96.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.38% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.27% | 98.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.98% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.89% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.62% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.56% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.67% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.66% | 99.23% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.62% | 93.65% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.91% | 92.62% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.57% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584985 |
| LOTUS | LTS0072534 |
| wikiData | Q77379963 |