8-Hydroxy-11-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one
| Internal ID | fdd4745f-3fc4-40bf-bba9-1d3cfbb17004 |
| Taxonomy | Alkaloids and derivatives > Indolonaphthyridine alkaloids |
| IUPAC Name | 8-hydroxy-11-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| SMILES (Canonical) | COC1=CC=CC2=C1C3=C4N2C(=O)C=CC4=NC=C3O |
| SMILES (Isomeric) | COC1=CC=CC2=C1C3=C4N2C(=O)C=CC4=NC=C3O |
| InChI | InChI=1S/C15H10N2O3/c1-20-11-4-2-3-9-13(11)14-10(18)7-16-8-5-6-12(19)17(9)15(8)14/h2-7,18H,1H3 |
| InChI Key | PGCMCHVRXMXNSW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06914219 g/mol |
| Topological Polar Surface Area (TPSA) | 64.40 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of 8-Hydroxy-11-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/a2192e70-8626-11ee-b2a0-c9af380812a2.jpg "2D Structure of 8-Hydroxy-11-methoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.85% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.43% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.36% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.29% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.92% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.32% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.92% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.38% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.92% | 89.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.86% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.81% | 99.23% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.92% | 97.36% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.57% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.00% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.83% | 99.15% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 84.10% | 85.30% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.00% | 93.10% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.55% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brucea mollis |
| PubChem | 86132504 |
| LOTUS | LTS0234274 |
| wikiData | Q105208313 |