[(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4,5-trimethoxybenzoate
Internal ID | 8f4c8b24-fcb6-4136-9c7d-088585dd2a27 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4,5-trimethoxybenzoate |
SMILES (Canonical) | CC(C)CCC(=O)C(C)C1(C(CC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)OC5C(C(C(CO5)O)OC6C(C(C(CO6)OC7C(C(C(C(O7)CO)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC)OC)OC)OC(=O)C)O |
SMILES (Isomeric) | C[C@H](C(=O)CCC(C)C)[C@]1([C@H](C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)O[C@H]5[C@@H]([C@H]([C@H](CO5)O)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC)OC)OC)OC(=O)C)O |
InChI | InChI=1S/C55H82O22/c1-25(2)10-13-34(59)26(3)55(66)40(21-33-31-12-11-29-20-30(58)14-16-53(29,5)32(31)15-17-54(33,55)6)75-52-48(72-27(4)57)45(35(60)23-70-52)77-51-47(76-49(65)28-18-36(67-7)46(69-9)37(19-28)68-8)42(62)39(24-71-51)74-50-44(64)43(63)41(61)38(22-56)73-50/h11,18-19,25-26,30-33,35,38-45,47-48,50-52,56,58,60-64,66H,10,12-17,20-24H2,1-9H3/t26-,30+,31-,32+,33+,35+,38-,39-,40+,41-,42+,43+,44-,45+,47-,48-,50+,51+,52+,53+,54+,55-/m1/s1 |
InChI Key | YUJSAXKLULOKFG-KIMQJBCHSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C55H82O22 |
Molecular Weight | 1095.20 g/mol |
Exact Mass | 1094.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 315.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4,5-trimethoxybenzoate 2D Structure of [(2S,3R,4S,5R)-2-[(2S,3R,4S,5S)-3-acetyloxy-2-[[(3S,8R,9S,10R,13S,14S,16S,17S)-3,17-dihydroxy-10,13-dimethyl-17-[(2S)-6-methyl-3-oxoheptan-2-yl]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxyoxan-4-yl]oxy-4-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 3,4,5-trimethoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/a1f5c900-8500-11ee-a367-0941a393fd9d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.19% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.75% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.13% | 99.17% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 94.81% | 92.98% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 94.69% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 93.79% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.45% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.99% | 96.00% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.19% | 97.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.60% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.56% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.53% | 97.14% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.47% | 91.19% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.28% | 95.17% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 89.24% | 93.18% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.21% | 91.24% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.19% | 92.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.11% | 92.62% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.04% | 95.93% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.88% | 91.07% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 86.53% | 89.05% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.29% | 90.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.03% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.82% | 93.56% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.57% | 96.43% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.00% | 95.89% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.93% | 95.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.83% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.63% | 96.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.55% | 94.45% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.30% | 89.50% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.89% | 96.90% |
CHEMBL5028 | O14672 | ADAM10 | 82.19% | 97.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.16% | 92.88% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.15% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.53% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.01% | 97.25% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.66% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum saundersiae |
PubChem | 10534213 |
LOTUS | LTS0102726 |
wikiData | Q105363056 |