(1R,4R,5R,7R)-5-hydroxy-4,5-dimethyl-7-[(4S,8R,9S,10R,13S,14R,17S)-4,14,17-trihydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxabicyclo[2.2.2]octan-3-one
| Internal ID | 6cfed2ab-e54a-4685-af76-09d522ba6c99 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Oxosteroids |
| IUPAC Name | (1R,4R,5R,7R)-5-hydroxy-4,5-dimethyl-7-[(4S,8R,9S,10R,13S,14R,17S)-4,14,17-trihydroxy-10,13-dimethyl-1-oxo-4,7,8,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxabicyclo[2.2.2]octan-3-one |
| SMILES (Canonical) | CC12CCC3C(C1(CCC2(C4CC5(C(=O)OC4CC5(C)O)C)O)O)CC=C6C3(C(=O)C=CC6O)C |
| SMILES (Isomeric) | C[C@]12CC[C@H]3[C@H]([C@@]1(CC[C@@]2([C@@H]4C[C@]5(C(=O)O[C@@H]4C[C@@]5(C)O)C)O)O)CC=C6[C@@]3(C(=O)C=C[C@@H]6O)C |
| InChI | InChI=1S/C28H38O7/c1-23-13-18(20(35-22(23)31)14-25(23,3)32)28(34)12-11-27(33)16-5-6-17-19(29)7-8-21(30)26(17,4)15(16)9-10-24(27,28)2/h6-8,15-16,18-20,29,32-34H,5,9-14H2,1-4H3/t15-,16+,18+,19-,20+,23-,24-,25+,26+,27+,28-/m0/s1 |
| InChI Key | HAZLYHDWDVSCBX-KRFCEVIWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.26175355 g/mol |
| Topological Polar Surface Area (TPSA) | 124.00 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.20% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.19% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.72% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.57% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.49% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.58% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.06% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.80% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.73% | 97.09% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.09% | 91.07% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.56% | 90.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 83.44% | 96.43% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.40% | 96.77% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.64% | 97.14% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.57% | 91.03% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.42% | 89.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.37% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Deprea orinocensis |
| PubChem | 102469054 |
| LOTUS | LTS0064568 |
| wikiData | Q105025151 |