16-Methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14(19),15,17-tetraene-12,20-dione
Internal ID | f11d7aaa-d740-442c-8c82-d1abe1930242 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 16-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14(19),15,17-tetraene-12,20-dione |
SMILES (Canonical) | CN1CCC23C4C5C(CC2=O)C(=CCOC5CC(=O)N4C6=C3C=CC(=C6)OC)C1 |
SMILES (Isomeric) | CN1CCC23C4C5C(CC2=O)C(=CCOC5CC(=O)N4C6=C3C=CC(=C6)OC)C1 |
InChI | InChI=1S/C23H26N2O4/c1-24-7-6-23-16-4-3-14(28-2)9-17(16)25-20(27)11-18-21(22(23)25)15(10-19(23)26)13(12-24)5-8-29-18/h3-5,9,15,18,21-22H,6-8,10-12H2,1-2H3 |
InChI Key | LQPYDIAIUWQRDY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H26N2O4 |
Molecular Weight | 394.50 g/mol |
Exact Mass | 394.18925731 g/mol |
Topological Polar Surface Area (TPSA) | 59.10 Ų |
XlogP | 0.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL204 | P00734 | Thrombin | 98.04% | 96.01% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.42% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.63% | 90.71% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.47% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.31% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.68% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.69% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.62% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.58% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 89.30% | 98.95% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.61% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.44% | 95.89% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.15% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.64% | 97.09% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 85.44% | 97.53% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 85.00% | 95.53% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.99% | 99.23% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.75% | 97.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.19% | 99.15% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.81% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos nux-vomica |
PubChem | 78385262 |
LOTUS | LTS0107809 |
wikiData | Q105155669 |