2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one
Internal ID | 2e754d61-f608-4ae2-a3d2-e8497bd6a94c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C(=C5)OC)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C(=C5)OC)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C28H32O17/c1-8-17(32)21(36)23(38)27(42-8)41-7-15-19(34)22(37)24(39)28(44-15)45-26-20(35)16-11(30)5-10(29)6-13(16)43-25(26)9-3-12(31)18(33)14(4-9)40-2/h3-6,8,15,17,19,21-24,27-34,36-39H,7H2,1-2H3/t8-,15+,17-,19+,21+,22-,23+,24+,27+,28-/m0/s1 |
InChI Key | IEPKWJCBNGNVDF-WQIPHUEGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H32O17 |
Molecular Weight | 640.50 g/mol |
Exact Mass | 640.16394955 g/mol |
Topological Polar Surface Area (TPSA) | 275.00 Ų |
XlogP | -1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.43% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.04% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.49% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.98% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.39% | 85.14% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.34% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.33% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.21% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 92.11% | 95.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.49% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 88.49% | 90.71% |
CHEMBL2424 | Q04760 | Glyoxalase I | 86.18% | 91.67% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.02% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.80% | 99.15% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 82.78% | 94.03% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.59% | 96.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.60% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.23% | 92.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.10% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abies nephrolepis |
Picea abies |
PubChem | 101682255 |
LOTUS | LTS0025756 |
wikiData | Q105111916 |