[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(6S)-6-(hydroxymethyl)-5,5-dimethyl-3-oxocyclohexen-1-yl]methoxy]oxan-2-yl]methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate
Internal ID | 038cf3e7-3c85-4dec-b1fc-262ee2c1e537 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(6S)-6-(hydroxymethyl)-5,5-dimethyl-3-oxocyclohexen-1-yl]methoxy]oxan-2-yl]methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1(CC(=O)C=C(C1CO)COC2C(C(C(C(O2)COC(=O)C=CC3=CC(=C(C(=C3)OC)O)OC)O)O)O)C |
SMILES (Isomeric) | CC1(CC(=O)C=C([C@H]1CO)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)/C=C/C3=CC(=C(C(=C3)OC)O)OC)O)O)O)C |
InChI | InChI=1S/C27H36O12/c1-27(2)10-16(29)9-15(17(27)11-28)12-38-26-25(34)24(33)23(32)20(39-26)13-37-21(30)6-5-14-7-18(35-3)22(31)19(8-14)36-4/h5-9,17,20,23-26,28,31-34H,10-13H2,1-4H3/b6-5+/t17-,20-,23-,24+,25-,26-/m1/s1 |
InChI Key | QDPPYFUKGGLDCP-FWMDYHNWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H36O12 |
Molecular Weight | 552.60 g/mol |
Exact Mass | 552.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 181.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.75% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.76% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.31% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.45% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.36% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.02% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.75% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.83% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.34% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.60% | 92.94% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 88.52% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.12% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 87.52% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.16% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.17% | 96.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.34% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.44% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.36% | 96.61% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.32% | 95.93% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.20% | 94.33% |
CHEMBL3194 | P02766 | Transthyretin | 80.37% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gardenia jasminoides |
PubChem | 163190562 |
LOTUS | LTS0198696 |
wikiData | Q105218915 |