8-[4-[4-(4,5-Dihydroxy-6-methyloxan-2-yl)oxy-2-methoxy-5,6-dimethyloxan-2-yl]-3-hydroxypentan-2-yl]-16-[4-(5-ethyl-2,4-dimethoxy-6-methyloxan-2-yl)-3-hydroxypentan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione
| Internal ID | ca21a28e-984a-433e-9c17-d19da466f485 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | 8-[4-[4-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-2-methoxy-5,6-dimethyloxan-2-yl]-3-hydroxypentan-2-yl]-16-[4-(5-ethyl-2,4-dimethoxy-6-methyloxan-2-yl)-3-hydroxypentan-2-yl]-7,15-dimethyl-1,9-dioxacyclohexadeca-3,5,11,13-tetraene-2,10-dione |
| SMILES (Canonical) | CCC1C(OC(CC1OC)(C(C)C(C(C)C2C(C=CC=CC(=O)OC(C(C=CC=CC(=O)O2)C)C(C)C(C(C)C3(CC(C(C(O3)C)C)OC4CC(C(C(O4)C)O)O)OC)O)C)O)OC)C |
| SMILES (Isomeric) | CCC1C(OC(CC1OC)(C(C)C(C(C)C2C(C=CC=CC(=O)OC(C(C=CC=CC(=O)O2)C)C(C)C(C(C)C3(CC(C(C(O3)C)C)OC4CC(C(C(O4)C)O)O)OC)O)C)O)OC)C |
| InChI | InChI=1S/C50H82O15/c1-15-37-35(10)65-50(59-14,26-40(37)57-12)33(8)45(55)31(6)48-28(3)21-17-19-22-41(52)62-47(27(2)20-16-18-23-42(53)63-48)30(5)44(54)32(7)49(58-13)25-39(29(4)34(9)64-49)61-43-24-38(51)46(56)36(11)60-43/h16-23,27-40,43-48,51,54-56H,15,24-26H2,1-14H3 |
| InChI Key | UNLNSORGTCIDCT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C50H82O15 |
| Molecular Weight | 923.20 g/mol |
| Exact Mass | 922.56537190 g/mol |
| Topological Polar Surface Area (TPSA) | 198.00 Ų |
| XlogP | 7.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.35% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.03% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.75% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.76% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.76% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.53% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.63% | 98.95% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.34% | 96.77% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.10% | 94.73% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.83% | 91.07% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.97% | 97.14% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.48% | 96.61% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.33% | 98.59% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.87% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.11% | 86.33% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.49% | 96.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.45% | 95.89% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.38% | 97.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.04% | 96.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.83% | 99.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.71% | 90.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.43% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.05% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72662265 |
| LOTUS | LTS0070283 |
| wikiData | Q104198402 |