methyl 5-ethylidene-4-[2-[[5-[1-[2-[3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxypropan-2-yl]-3-hydroxy-2-methylcyclopentyl]methoxy]-2-oxoethyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate
Internal ID | 866dd6cb-f3f4-4ad3-b4df-26f1bb537785 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | methyl 5-ethylidene-4-[2-[[5-[1-[2-[3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxypropan-2-yl]-3-hydroxy-2-methylcyclopentyl]methoxy]-2-oxoethyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
SMILES (Canonical) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCC3C(C(CC3C(C)COC(=O)CC4C(=COC(C4=CC)OC5C(C(C(C(O5)CO)O)O)O)C(=O)OC)O)C |
SMILES (Isomeric) | CC=C1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)OC)CC(=O)OCC3C(C(CC3C(C)COC(=O)CC4C(=COC(C4=CC)OC5C(C(C(C(O5)CO)O)O)O)C(=O)OC)O)C |
InChI | InChI=1S/C44H64O23/c1-7-20-23(26(39(56)58-5)16-62-41(20)66-43-37(54)35(52)33(50)29(12-45)64-43)10-31(48)60-14-18(3)22-9-28(47)19(4)25(22)15-61-32(49)11-24-21(8-2)42(63-17-27(24)40(57)59-6)67-44-38(55)36(53)34(51)30(13-46)65-44/h7-8,16-19,22-25,28-30,33-38,41-47,50-55H,9-15H2,1-6H3 |
InChI Key | XIWWQRZPJXTMEF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H64O23 |
Molecular Weight | 961.00 g/mol |
Exact Mass | 960.38383828 g/mol |
Topological Polar Surface Area (TPSA) | 343.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
![2D Structure of methyl 5-ethylidene-4-[2-[[5-[1-[2-[3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxypropan-2-yl]-3-hydroxy-2-methylcyclopentyl]methoxy]-2-oxoethyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate 2D Structure of methyl 5-ethylidene-4-[2-[[5-[1-[2-[3-ethylidene-5-methoxycarbonyl-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-4-yl]acetyl]oxypropan-2-yl]-3-hydroxy-2-methylcyclopentyl]methoxy]-2-oxoethyl]-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/a18d8390-86a6-11ee-a209-89372849f4cb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.13% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.79% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.08% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 90.96% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.94% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.46% | 96.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.56% | 85.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.45% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.13% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.87% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.53% | 99.17% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.12% | 94.80% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.84% | 97.79% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.45% | 85.31% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.99% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.68% | 86.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.56% | 95.83% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.49% | 80.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.36% | 86.92% |
CHEMBL5028 | O14672 | ADAM10 | 82.14% | 97.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.08% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.02% | 94.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.14% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jasminum nudiflorum |
PubChem | 73109663 |
LOTUS | LTS0153296 |
wikiData | Q105328786 |