3,4,11,19-Tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-5-ol
| Internal ID | 6a40c51c-567c-4b2c-8e76-e1678e81551e |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | 3,4,11,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-5-ol |
| SMILES (Canonical) | CC1CC2=CC(=C(C(=C2C3=C(C4=C(C=C3C(C1C)OC)OCO4)OC)OC)OC)O |
| SMILES (Isomeric) | CC1CC2=CC(=C(C(=C2C3=C(C4=C(C=C3C(C1C)OC)OCO4)OC)OC)OC)O |
| InChI | InChI=1S/C23H28O7/c1-11-7-13-8-15(24)20(26-4)22(27-5)17(13)18-14(19(25-3)12(11)2)9-16-21(23(18)28-6)30-10-29-16/h8-9,11-12,19,24H,7,10H2,1-6H3 |
| InChI Key | WYKCWLMVRLFACA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 75.60 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of 3,4,11,19-Tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/a15c3420-86f0-11ee-b693-37444491fc49.jpg "2D Structure of 3,4,11,19-Tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaen-5-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.91% | 96.09% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.13% | 91.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.26% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.04% | 96.77% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 89.66% | 96.76% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 88.59% | 82.67% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.24% | 92.62% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 87.82% | 80.96% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 87.79% | 95.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.06% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.73% | 85.14% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.25% | 94.80% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.78% | 91.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.30% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.23% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.15% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.89% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.71% | 92.94% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.53% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.33% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.79% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.66% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.64% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schisandra lancifolia |
| Schisandra rubriflora |
| PubChem | 75149524 |
| LOTUS | LTS0176874 |
| wikiData | Q105322341 |