3-hydroxy-N-[3-[8-[(E)-6-hydroxy-3,5-dimethylhept-4-enyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl]-4-[[2-[6-[(E)-2-hydroxypent-3-enyl]-4-methyloxan-2-yl]acetyl]amino]-2-methylbutanamide
| Internal ID | 0c43ba76-9031-43ae-b3d8-4f9aa1e33234 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Amino acids and derivatives > Gamma amino acids and derivatives |
| IUPAC Name | 3-hydroxy-N-[3-[8-[(E)-6-hydroxy-3,5-dimethylhept-4-enyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl]-4-[[2-[6-[(E)-2-hydroxypent-3-enyl]-4-methyloxan-2-yl]acetyl]amino]-2-methylbutanamide |
| SMILES (Canonical) | CC=CC(CC1CC(CC(O1)CC(=O)NCC(C(C)C(=O)NCCCC2C(CCC3(O2)CCCC(O3)CCC(C)C=C(C)C(C)O)C)O)C)O |
| SMILES (Isomeric) | C/C=C/C(CC1CC(CC(O1)CC(=O)NCC(C(C)C(=O)NCCCC2C(CCC3(O2)CCCC(O3)CCC(C)/C=C(\C)/C(C)O)C)O)C)O |
| InChI | InChI=1S/C40H70N2O8/c1-8-11-32(44)23-34-21-27(3)22-35(48-34)24-38(46)42-25-36(45)30(6)39(47)41-19-10-13-37-28(4)16-18-40(50-37)17-9-12-33(49-40)15-14-26(2)20-29(5)31(7)43/h8,11,20,26-28,30-37,43-45H,9-10,12-19,21-25H2,1-7H3,(H,41,47)(H,42,46)/b11-8+,29-20+ |
| InChI Key | RJOSUTGDUUPBKV-KNEXMGAHSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C40H70N2O8 |
| Molecular Weight | 707.00 g/mol |
| Exact Mass | 706.51321720 g/mol |
| Topological Polar Surface Area (TPSA) | 147.00 Ų |
| XlogP | 5.30 |
| Atomic LogP (AlogP) | 5.72 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 18 |
| 3-hydroxy-N-[3-[8-[(E)-6-hydroxy-3,5-dimethylhept-4-enyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]propyl]-4-[[2-[6-[(E)-2-hydroxypent-3-enyl]-4-methyloxan-2-yl]acetyl]amino]-2-methylbutanamide |
| 2H-Pyran-2-acetamide, tetrahydro-6-(2-hydroxy-3-pentenyl)-N-(2-hydroxy-4-((3-(8-(6-hydroxy-3,5-dimethyl-4-heptenyl)-3-methyl-1,7-dioxaspiro(5.5)undec-2-yl)propyl)amino)-3-methyl-4-oxobutyl)-4-methyl- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.8135 | 81.35% |
| Caco-2 | - | 0.8599 | 85.99% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.7469 | 74.69% |
| OATP2B1 inhibitior | - | 0.5824 | 58.24% |
| OATP1B1 inhibitior | + | 0.8368 | 83.68% |
| OATP1B3 inhibitior | + | 0.9229 | 92.29% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.8334 | 83.34% |
| P-glycoprotein inhibitior | + | 0.7371 | 73.71% |
| P-glycoprotein substrate | + | 0.7712 | 77.12% |
| CYP3A4 substrate | + | 0.7315 | 73.15% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8545 | 85.45% |
| CYP3A4 inhibition | - | 0.7903 | 79.03% |
| CYP2C9 inhibition | - | 0.8926 | 89.26% |
| CYP2C19 inhibition | - | 0.8572 | 85.72% |
| CYP2D6 inhibition | - | 0.9119 | 91.19% |
| CYP1A2 inhibition | - | 0.8891 | 88.91% |
| CYP2C8 inhibition | + | 0.7064 | 70.64% |
| CYP inhibitory promiscuity | - | 0.9542 | 95.42% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.5732 | 57.32% |
| Eye corrosion | - | 0.9874 | 98.74% |
| Eye irritation | - | 0.9175 | 91.75% |
| Skin irritation | - | 0.7611 | 76.11% |
| Skin corrosion | - | 0.9387 | 93.87% |
| Ames mutagenesis | - | 0.6700 | 67.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7388 | 73.88% |
| Micronuclear | + | 0.6700 | 67.00% |
| Hepatotoxicity | - | 0.5869 | 58.69% |
| skin sensitisation | - | 0.8621 | 86.21% |
| Respiratory toxicity | - | 0.5222 | 52.22% |
| Reproductive toxicity | + | 0.7333 | 73.33% |
| Mitochondrial toxicity | + | 0.8625 | 86.25% |
| Nephrotoxicity | - | 0.6125 | 61.25% |
| Acute Oral Toxicity (c) | III | 0.6291 | 62.91% |
| Estrogen receptor binding | + | 0.8282 | 82.82% |
| Androgen receptor binding | + | 0.6398 | 63.98% |
| Thyroid receptor binding | - | 0.5571 | 55.71% |
| Glucocorticoid receptor binding | + | 0.7237 | 72.37% |
| Aromatase binding | + | 0.6516 | 65.16% |
| PPAR gamma | + | 0.6957 | 69.57% |
| Honey bee toxicity | - | 0.6707 | 67.07% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.8099 | 80.99% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.98% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.62% | 98.95% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 97.88% | 95.58% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.24% | 98.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.20% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.89% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.85% | 91.19% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.68% | 97.14% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.60% | 98.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.48% | 100.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.01% | 95.71% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 90.97% | 92.88% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.97% | 95.50% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.68% | 85.31% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.39% | 100.00% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 90.12% | 96.33% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 89.96% | 97.31% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.77% | 96.47% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 89.41% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.24% | 94.45% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.03% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.97% | 94.73% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.94% | 92.50% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.78% | 90.08% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 87.14% | 91.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.12% | 89.50% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 87.00% | 96.28% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 86.45% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.39% | 89.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 86.04% | 98.03% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 85.46% | 97.64% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.15% | 96.21% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.84% | 99.23% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.60% | 89.33% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 84.58% | 97.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.49% | 95.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 84.34% | 94.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.25% | 96.67% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.21% | 97.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.01% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.51% | 99.17% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.51% | 95.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.47% | 93.56% |
| CHEMBL3785 | Q8TDS4 | Hydroxycarboxylic acid receptor 2 | 82.35% | 94.05% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.15% | 89.67% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.92% | 97.50% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.02% | 82.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.87% | 94.66% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.69% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6439503 |
| LOTUS | LTS0107048 |
| wikiData | Q105237643 |