[(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5S,6R)-4-hydroxy-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate
Internal ID | beba6aa1-4cf8-4e2e-8bcb-06958cc71d5b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17S)-17-acetyl-8,14,17-trihydroxy-3-[(2R,4S,5S,6R)-4-hydroxy-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5R,6R)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] benzoate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4O)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C9=CC=CC=C9)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4O)O[C@H]5CC[C@@]6([C@H]7C[C@H]([C@@]8([C@@](CC[C@@]8([C@@]7(CC=C6C5)O)O)(C(=O)C)O)C)OC(=O)C9=CC=CC=C9)C)C)C)C)OC)O |
InChI | InChI=1S/C55H82O19/c1-28-46(58)37(63-8)24-43(66-28)73-48-31(4)69-45(26-39(48)65-10)74-49-30(3)68-44(25-38(49)64-9)72-47-29(2)67-42(23-36(47)57)70-35-17-18-51(6)34(22-35)16-19-54(61)40(51)27-41(71-50(59)33-14-12-11-13-15-33)52(7)53(60,32(5)56)20-21-55(52,54)62/h11-16,28-31,35-49,57-58,60-62H,17-27H2,1-10H3/t28-,29-,30-,31-,35+,36+,37-,38+,39-,40-,41-,42+,43+,44+,45+,46-,47-,48-,49-,51+,52-,53-,54+,55-/m1/s1 |
InChI Key | QZUYNWNKCRNRLD-DVUDMZGASA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H82O19 |
Molecular Weight | 1047.20 g/mol |
Exact Mass | 1046.54503038 g/mol |
Topological Polar Surface Area (TPSA) | 246.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.39% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.92% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.50% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.93% | 91.11% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 91.55% | 91.07% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.75% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.56% | 85.14% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.94% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.09% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.02% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 88.20% | 97.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.15% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.89% | 90.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.42% | 97.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.05% | 95.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 85.88% | 94.08% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.35% | 97.09% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 83.80% | 94.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.06% | 95.89% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.38% | 97.33% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.31% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.95% | 94.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.66% | 100.00% |
CHEMBL4267 | P37173 | TGF-beta receptor type II | 80.35% | 88.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias curassavica |
PubChem | 163007341 |
LOTUS | LTS0196297 |
wikiData | Q105232391 |