3,4,15-Trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-16-ol
| Internal ID | 74f7ea7c-dd98-426b-8176-919c48779e12 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 3,4,15-trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-16-ol |
| SMILES (Canonical) | CN1CCC2=CC(=C(C3=C4C(=CC1=C23)C=CC(=C4OC)OC)O)OC |
| SMILES (Isomeric) | CN1CCC2=CC(=C(C3=C4C(=CC1=C23)C=CC(=C4OC)OC)O)OC |
| InChI | InChI=1S/C20H21NO4/c1-21-8-7-12-10-15(24-3)19(22)18-16(12)13(21)9-11-5-6-14(23-2)20(25-4)17(11)18/h5-6,9-10,22H,7-8H2,1-4H3 |
| InChI Key | JBRXGCUFNVHPJC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 51.20 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
![2D Structure of 3,4,15-Trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-16-ol](https://plantaedb.com/storage/docs/compounds/2023/11/a12ec220-83ea-11ee-b1f8-251c762120f0.jpg "2D Structure of 3,4,15-Trimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaen-16-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.56% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.98% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 92.97% | 90.00% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 91.04% | 95.62% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 90.85% | 91.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.80% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.29% | 92.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.91% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.52% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.33% | 90.20% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.63% | 95.89% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.71% | 95.89% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.68% | 93.65% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.88% | 89.62% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.59% | 92.68% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.22% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glaucium fimbrilligerum |
| PubChem | 23266907 |
| LOTUS | LTS0094801 |
| wikiData | Q104394349 |