(4S,5S)-7,9-dibromo-N-[3-[2,6-dibromo-4-[2-[(2,5-dioxocyclopent-3-en-1-ylidene)methylamino]ethyl]phenoxy]propyl]-4-hydroxy-8-methoxy-1,11-dioxa-2-azaspiro[4.6]undeca-2,7,9-triene-3-carboxamide
| Internal ID | bc596fe9-fa03-4289-a638-2feb4e80e584 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Phenethylamines |
| IUPAC Name | (4S,5S)-7,9-dibromo-N-[3-[2,6-dibromo-4-[2-[(2,5-dioxocyclopent-3-en-1-ylidene)methylamino]ethyl]phenoxy]propyl]-4-hydroxy-8-methoxy-1,11-dioxa-2-azaspiro[4.6]undeca-2,7,9-triene-3-carboxamide |
| SMILES (Canonical) | COC1=C(CC2(C(C(=NO2)C(=O)NCCCOC3=C(C=C(C=C3Br)CCNC=C4C(=O)C=CC4=O)Br)O)OC=C1Br)Br |
| SMILES (Isomeric) | COC1=C(C[C@]2([C@H](C(=NO2)C(=O)NCCCOC3=C(C=C(C=C3Br)CCNC=C4C(=O)C=CC4=O)Br)O)OC=C1Br)Br |
| InChI | InChI=1S/C27H25Br4N3O8/c1-39-23-18(30)11-27(41-13-19(23)31)25(37)22(34-42-27)26(38)33-6-2-8-40-24-16(28)9-14(10-17(24)29)5-7-32-12-15-20(35)3-4-21(15)36/h3-4,9-10,12-13,25,32,37H,2,5-8,11H2,1H3,(H,33,38)/t25-,27-/m0/s1 |
| InChI Key | JGFXDUSJSHIVCW-BDYUSTAISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H25Br4N3O8 |
| Molecular Weight | 839.10 g/mol |
| Exact Mass | 838.83342 g/mol |
| Topological Polar Surface Area (TPSA) | 145.00 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.13% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.87% | 97.25% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.87% | 95.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.62% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.80% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.63% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.42% | 98.95% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 93.09% | 91.07% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 91.81% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.72% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.32% | 94.73% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.64% | 91.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.61% | 86.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.19% | 89.34% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 89.88% | 90.24% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 88.64% | 92.88% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.56% | 95.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.48% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.74% | 90.71% |
| CHEMBL3891 | P07384 | Calpain 1 | 86.39% | 93.04% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.67% | 97.33% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 84.12% | 95.34% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.82% | 93.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.75% | 89.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.50% | 90.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.15% | 96.90% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 76853468 |
| LOTUS | LTS0074431 |
| wikiData | Q105127323 |