(1R,2R,7S,10S,12S,13R,14S,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-12-(2-oxopropyl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione
| Internal ID | 18356a6b-b071-4408-9729-476509af7b8f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
| IUPAC Name | (1R,2R,7S,10S,12S,13R,14S,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-12-(2-oxopropyl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione |
| SMILES (Canonical) | CC(=O)CC1CC2C(OC3C2(COC(=O)C3)C4C1(C56C(O5)C(=O)OC(C6(CC4)C)C7=COC=C7)C)(C)C |
| SMILES (Isomeric) | CC(=O)C[C@@H]1C[C@H]2[C@@]3(COC(=O)C[C@@H]3OC2(C)C)[C@@H]4[C@@]1([C@]56[C@H](O5)C(=O)O[C@H]([C@@]6(CC4)C)C7=COC=C7)C |
| InChI | InChI=1S/C29H36O8/c1-15(30)10-17-11-19-25(2,3)36-20-12-21(31)34-14-28(19,20)18-6-8-26(4)22(16-7-9-33-13-16)35-24(32)23-29(26,37-23)27(17,18)5/h7,9,13,17-20,22-23H,6,8,10-12,14H2,1-5H3/t17-,18+,19-,20+,22+,23-,26+,27-,28-,29-/m1/s1 |
| InChI Key | UEYGVZMYXRRXJN-DQAGOPFHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24101810 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of (1R,2R,7S,10S,12S,13R,14S,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-12-(2-oxopropyl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione](https://plantaedb.com/storage/docs/compounds/2023/11/a10620e0-86bb-11ee-bed7-f1d8744f2449.jpg "2D Structure of (1R,2R,7S,10S,12S,13R,14S,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-12-(2-oxopropyl)-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,17-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.97% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.13% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.20% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.25% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.76% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.54% | 82.69% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.27% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.87% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.84% | 89.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.02% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.01% | 92.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.64% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.10% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus × aurantium |
| PubChem | 162998667 |
| LOTUS | LTS0057024 |
| wikiData | Q105271199 |