(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R,5R)-5-[(1S,2R)-2-methylcyclopropyl]hexan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one
| Internal ID | 309ce8ae-6baa-40af-a33a-4d686d4b0527 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cholestane steroids > Cholesterols and derivatives |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R,5R)-5-[(1S,2R)-2-methylcyclopropyl]hexan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
| SMILES (Canonical) | CC1CC1C(C)CCC(C)C2CCC3C2(CCC4C3C(=O)C=C5C4(CCC(C5)O)C)C |
| SMILES (Isomeric) | C[C@@H]1C[C@@H]1[C@H](C)CC[C@@H](C)[C@H]2CC[C@@H]3[C@@]2(CC[C@H]4[C@H]3C(=O)C=C5[C@@]4(CC[C@@H](C5)O)C)C |
| InChI | InChI=1S/C29H46O2/c1-17(22-14-19(22)3)6-7-18(2)23-8-9-24-27-25(11-13-29(23,24)5)28(4)12-10-21(30)15-20(28)16-26(27)31/h16-19,21-25,27,30H,6-15H2,1-5H3/t17-,18-,19-,21+,22-,23-,24+,25+,27+,28+,29-/m1/s1 |
| InChI Key | MDEVBHGFFDDBHC-XULDMYTQSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.349780706 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 7.80 |
| RefChem:914412 |
| 26,27-cyclo-24,27-dimethyl-3beta-hydroxycholest-5-en-7-one |
| (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-((2R,5R)-5-((1S,2R)-2-methylcyclopropyl)hexan-2-yl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta(a)phenanthren-7-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.32% | 95.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.16% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.69% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.51% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.87% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.18% | 90.71% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.94% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.02% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 90.22% | 96.43% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.28% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.12% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.85% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.22% | 94.45% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.94% | 93.04% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.06% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.64% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.57% | 86.33% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 81.63% | 85.31% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.56% | 90.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.27% | 93.00% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.08% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101209534 |
| LOTUS | LTS0131860 |
| wikiData | Q105161669 |