2-[2-(3',6'-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-5-hydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | a426680b-bd90-4bd7-896b-5af029725d42 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-(3',6'-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-5-hydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1O)O |
SMILES (Isomeric) | CC1CC(C2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1O)O |
InChI | InChI=1S/C44H70O18/c1-17-12-28(47)44(62-38(17)54)18(2)29-26(61-44)14-24-22-7-6-20-13-21(8-10-42(20,4)23(22)9-11-43(24,29)5)57-41-37(60-40-35(53)33(51)30(48)19(3)56-40)36(32(50)27(15-45)58-41)59-39-34(52)31(49)25(46)16-55-39/h6,17-19,21-41,45-54H,7-16H2,1-5H3 |
InChI Key | YGPVRHSBAWKDQT-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H70O18 |
Molecular Weight | 887.00 g/mol |
Exact Mass | 886.45621538 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of 2-[2-(3',6'-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-5-hydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol 2D Structure of 2-[2-(3',6'-Dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxy-5-hydroxy-6-(hydroxymethyl)-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/a0c0e8b0-845e-11ee-a9e4-838867324b2f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.74% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 98.00% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.94% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.90% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.85% | 89.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.31% | 94.75% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 89.26% | 95.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.02% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.83% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.27% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.97% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.66% | 97.25% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.44% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 84.33% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.05% | 96.61% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.18% | 96.77% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.76% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.41% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.98% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.58% | 92.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.41% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum anguivi |
Solanum lasiocarpum |
PubChem | 73798998 |
LOTUS | LTS0080267 |
wikiData | Q105348215 |