methyl (2R,6R)-6-[(3S,5R,10S,13R,14R,15S,17R)-3,15-dihydroxy-4,4,10,13,14-pentamethyl-11-oxo-1,2,3,5,6,7,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoate
| Internal ID | 9ebd1244-02af-453d-8709-db9116e8afee |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | methyl (2R,6R)-6-[(3S,5R,10S,13R,14R,15S,17R)-3,15-dihydroxy-4,4,10,13,14-pentamethyl-11-oxo-1,2,3,5,6,7,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoate |
| SMILES (Canonical) | CC(CC(=O)CC(C)C(=O)OC)C1CC(C2(C1(CC(=O)C3=C2CCC4C3(CCC(C4(C)C)O)C)C)C)O |
| SMILES (Isomeric) | C[C@H](CC(=O)C[C@@H](C)C(=O)OC)[C@H]1C[C@@H]([C@@]2([C@@]1(CC(=O)C3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C)O |
| InChI | InChI=1S/C31H48O6/c1-17(13-19(32)14-18(2)27(36)37-8)21-15-25(35)31(7)20-9-10-23-28(3,4)24(34)11-12-29(23,5)26(20)22(33)16-30(21,31)6/h17-18,21,23-25,34-35H,9-16H2,1-8H3/t17-,18-,21-,23+,24+,25+,29+,30-,31-/m1/s1 |
| InChI Key | FROUXXYVOAIKFY-PNXVDQOQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C31H48O6 |
| Molecular Weight | 516.70 g/mol |
| Exact Mass | 516.34508925 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.47% | 90.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.04% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.26% | 91.11% |
| CHEMBL240 | Q12809 | HERG | 95.98% | 89.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.89% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.99% | 97.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 88.22% | 96.38% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.07% | 97.79% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.45% | 93.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.36% | 91.07% |
| CHEMBL5028 | O14672 | ADAM10 | 85.22% | 97.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.18% | 91.19% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.08% | 97.25% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.72% | 94.33% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.20% | 94.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.69% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.57% | 96.77% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.08% | 94.00% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.56% | 92.78% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.54% | 95.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.48% | 92.62% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.35% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.21% | 95.89% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 80.94% | 92.95% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.43% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162931005 |
| LOTUS | LTS0079927 |
| wikiData | Q105000346 |