[1,8,13,16-Tetraacetyloxy-2-(2-acetyloxyacetyl)oxy-7,14-dihydroxy-5,9,12,12-tetramethyl-11-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadecanyl] benzoate
| Internal ID | dddad2fa-75ab-4ff1-88d1-23fe6e01e4c9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | [1,8,13,16-tetraacetyloxy-2-(2-acetyloxyacetyl)oxy-7,14-dihydroxy-5,9,12,12-tetramethyl-11-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadecanyl] benzoate |
| SMILES (Canonical) | CC1CC2(C(C1OC(=O)C3=CC=CC=C3)C(C4(CC5(C(C(=O)C(C5OC(=O)C)(C)C)C(C2OC(=O)C)(C4OC(=O)C)C)O)OC(=O)C)OC(=O)COC(=O)C)O |
| SMILES (Isomeric) | CC1CC2(C(C1OC(=O)C3=CC=CC=C3)C(C4(CC5(C(C(=O)C(C5OC(=O)C)(C)C)C(C2OC(=O)C)(C4OC(=O)C)C)O)OC(=O)C)OC(=O)COC(=O)C)O |
| InChI | InChI=1S/C39H48O17/c1-18-15-37(48)26(27(18)55-31(47)24-13-11-10-12-14-24)30(54-25(45)16-50-19(2)40)39(56-23(6)44)17-38(49)28(29(46)35(7,8)32(38)51-20(3)41)36(9,33(37)52-21(4)42)34(39)53-22(5)43/h10-14,18,26-28,30,32-34,48-49H,15-17H2,1-9H3 |
| InChI Key | OKUOZMUXYVGYRY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C39H48O17 |
| Molecular Weight | 788.80 g/mol |
| Exact Mass | 788.28915006 g/mol |
| Topological Polar Surface Area (TPSA) | 242.00 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of [1,8,13,16-Tetraacetyloxy-2-(2-acetyloxyacetyl)oxy-7,14-dihydroxy-5,9,12,12-tetramethyl-11-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadecanyl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/a08fd7e0-8639-11ee-abb1-27c2646e17a7.jpg "2D Structure of [1,8,13,16-Tetraacetyloxy-2-(2-acetyloxyacetyl)oxy-7,14-dihydroxy-5,9,12,12-tetramethyl-11-oxo-4-tetracyclo[7.6.1.03,7.010,14]hexadecanyl] benzoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.33% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.24% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.13% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.78% | 91.11% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.77% | 83.00% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.73% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.60% | 95.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 88.00% | 97.79% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.64% | 99.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.38% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.06% | 90.17% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 84.23% | 92.67% |
| CHEMBL5028 | O14672 | ADAM10 | 83.58% | 97.50% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.25% | 93.03% |
| CHEMBL6007 | O75762 | Transient receptor potential cation channel subfamily A member 1 | 81.45% | 92.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.90% | 97.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.40% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia paralias |
| PubChem | 73409370 |
| LOTUS | LTS0071221 |
| wikiData | Q105193772 |