[3-acetyloxy-5-[(E)-2-[(8bS,14aS)-2,4,6,7-tetraacetyloxy-8b,14a-dihydrophenanthro[9,10-b][1,4]benzodioxin-11-yl]ethenyl]phenyl] acetate
Internal ID | 13129b62-c514-4092-b957-57af5aae7c74 |
Taxonomy | Lignans, neolignans and related compounds > Stilbenolignans |
IUPAC Name | [3-acetyloxy-5-[(E)-2-[(8bS,14aS)-2,4,6,7-tetraacetyloxy-8b,14a-dihydrophenanthro[9,10-b][1,4]benzodioxin-11-yl]ethenyl]phenyl] acetate |
SMILES (Canonical) | CC(=O)OC1=CC(=CC(=C1)C=CC2=CC3=C(C=C2)OC4C(O3)C5=CC(=C(C=C5C6=C4C=C(C=C6OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC(=O)OC1=CC(=CC(=C1)/C=C/C2=CC3=C(C=C2)O[C@@H]4[C@@H](O3)C5=CC(=C(C=C5C6=C4C=C(C=C6OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C40H32O14/c1-19(41)47-27-11-26(12-28(14-27)48-20(2)42)8-7-25-9-10-33-34(13-25)54-39-31-18-36(51-23(5)45)35(50-22(4)44)17-30(31)38-32(40(39)53-33)15-29(49-21(3)43)16-37(38)52-24(6)46/h7-18,39-40H,1-6H3/b8-7+/t39-,40-/m0/s1 |
InChI Key | SDJWLMPMAVSKCD-DWIJEPTLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H32O14 |
Molecular Weight | 736.70 g/mol |
Exact Mass | 736.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 176.00 Ų |
XlogP | 5.20 |
There are no found synonyms. |
![2D Structure of [3-acetyloxy-5-[(E)-2-[(8bS,14aS)-2,4,6,7-tetraacetyloxy-8b,14a-dihydrophenanthro[9,10-b][1,4]benzodioxin-11-yl]ethenyl]phenyl] acetate 2D Structure of [3-acetyloxy-5-[(E)-2-[(8bS,14aS)-2,4,6,7-tetraacetyloxy-8b,14a-dihydrophenanthro[9,10-b][1,4]benzodioxin-11-yl]ethenyl]phenyl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/a08c9970-837d-11ee-9f20-1dfdc07f9c93.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.97% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.16% | 95.56% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 93.83% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.54% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.88% | 89.00% |
CHEMBL240 | Q12809 | HERG | 92.79% | 89.76% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.29% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 91.72% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.14% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.03% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.10% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.79% | 94.80% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.89% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senna garrettiana |
PubChem | 163185658 |
LOTUS | LTS0214466 |
wikiData | Q105250688 |