[5-[5-(4,5-Dihydroxy-4,6-dimethyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl] 2-[4,10-dihydroxy-8-(3-hydroxypentan-2-yl)-3,5,9,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate
| Internal ID | c5b8702d-adff-481e-8ec5-c80350d07419 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | [5-[5-(4,5-dihydroxy-4,6-dimethyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl] 2-[4,10-dihydroxy-8-(3-hydroxypentan-2-yl)-3,5,9,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate |
| SMILES (Canonical) | CCC(C(C)C1C(C(C(C2(O1)C(C(C(C(O2)C(C)C(=O)OC3CC(C(C(O3)C)OC4CCC(C(O4)C)OC5CC(C(C(O5)C)O)(C)O)O)C)O)C)C)O)C)O |
| SMILES (Isomeric) | CCC(C(C)C1C(C(C(C2(O1)C(C(C(C(O2)C(C)C(=O)OC3CC(C(C(O3)C)OC4CCC(C(O4)C)OC5CC(C(C(O5)C)O)(C)O)O)C)O)C)C)O)C)O |
| InChI | InChI=1S/C40H70O15/c1-12-26(41)17(2)34-18(3)32(43)21(6)40(54-34)22(7)33(44)19(4)35(55-40)20(5)38(46)53-30-15-27(42)36(24(9)49-30)52-29-14-13-28(23(8)48-29)51-31-16-39(11,47)37(45)25(10)50-31/h17-37,41-45,47H,12-16H2,1-11H3 |
| InChI Key | CBKADAVICKKBON-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H70O15 |
| Molecular Weight | 791.00 g/mol |
| Exact Mass | 790.47147152 g/mol |
| Topological Polar Surface Area (TPSA) | 212.00 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of [5-[5-(4,5-Dihydroxy-4,6-dimethyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl] 2-[4,10-dihydroxy-8-(3-hydroxypentan-2-yl)-3,5,9,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate](https://plantaedb.com/storage/docs/compounds/2023/11/a0806bd0-868a-11ee-aba8-8771ef4bbc07.jpg "2D Structure of [5-[5-(4,5-Dihydroxy-4,6-dimethyloxan-2-yl)oxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl] 2-[4,10-dihydroxy-8-(3-hydroxypentan-2-yl)-3,5,9,11-tetramethyl-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.72% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.29% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.86% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.66% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.48% | 97.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.79% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.34% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.47% | 94.45% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.86% | 95.93% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 90.59% | 97.79% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.94% | 96.95% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.92% | 97.14% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.79% | 96.38% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.78% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.71% | 89.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.57% | 92.62% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.48% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.61% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.31% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.48% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.45% | 92.50% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 84.33% | 83.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.32% | 96.61% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.23% | 100.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.53% | 82.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.46% | 91.07% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.57% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.03% | 91.19% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.03% | 85.30% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.82% | 93.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.82% | 96.47% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.60% | 89.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.44% | 98.75% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.28% | 91.24% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.18% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72960220 |
| LOTUS | LTS0197528 |
| wikiData | Q103817515 |