(1S,5R)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one
| Internal ID | 8d3eeeab-601e-417a-ba97-da625faf64e8 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > 2-heteroaryl carboxamides |
| IUPAC Name | (1S,5R)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H11Br2N5O/c12-5-4-6(15-8(5)13)9(19)18-3-1-2-11(18)7(4)16-10(14)17-11/h7,15H,1-3H2,(H3,14,16,17)/t7-,11+/m1/s1 |
| InChI Key | DDCWMFYLYYJVTF-HQJQHLMTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H11Br2N5O |
| Molecular Weight | 389.05 g/mol |
| Exact Mass | 388.93099 g/mol |
| Topological Polar Surface Area (TPSA) | 86.50 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
![2D Structure of (1S,5R)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one](https://plantaedb.com/storage/docs/compounds/2023/11/a069b810-85d5-11ee-9b7a-99a3513f14e0.jpg "2D Structure of (1S,5R)-3-amino-7,8-dibromo-2,4,9,12-tetrazatetracyclo[10.3.0.01,5.06,10]pentadeca-3,6(10),7-trien-11-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.02% | 94.45% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 95.56% | 95.69% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 93.54% | 99.29% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.98% | 97.25% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.24% | 94.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.21% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.97% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.66% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.83% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.47% | 90.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.45% | 90.08% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.02% | 88.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.10% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.89% | 93.03% |
| CHEMBL238 | Q01959 | Dopamine transporter | 86.81% | 95.88% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 86.49% | 94.78% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.43% | 89.63% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.31% | 93.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.33% | 93.04% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 84.55% | 94.50% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 84.44% | 93.40% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.27% | 90.71% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.89% | 94.42% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.79% | 93.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.36% | 95.89% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.67% | 83.82% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.88% | 90.24% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.74% | 98.99% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.66% | 98.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.53% | 92.94% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 81.24% | 80.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.37% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53753974 |
| LOTUS | LTS0066090 |
| wikiData | Q104976213 |