[(3R,4R,5S,6S,7R,16R,17S,18R,19R,20R)-17-benzoyloxy-5,18-dihydroxy-10,23-dioxo-6,19-bis[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-2,9,15,22,29,32-hexaoxapentacyclo[22.2.2.211,14.13,7.116,20]dotriaconta-1(27),11,13,24(28),25,30-hexaen-4-yl] benzoate
Internal ID | 6513822d-0fd5-48c3-956b-cbf5b7683cef |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
IUPAC Name | [(3R,4R,5S,6S,7R,16R,17S,18R,19R,20R)-17-benzoyloxy-5,18-dihydroxy-10,23-dioxo-6,19-bis[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-2,9,15,22,29,32-hexaoxapentacyclo[22.2.2.211,14.13,7.116,20]dotriaconta-1(27),11,13,24(28),25,30-hexaen-4-yl] benzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC3=CC=C(C=C3)C(=O)OCC4C(C(C(C(O4)OC5=CC=C(C=C5)C(=O)O1)OC(=O)C6=CC=CC=C6)O)OC7C(C(C(C(O7)CO)O)O)O)OC(=O)C8=CC=CC=C8)O)OC9C(C(C(C(O9)CO)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)OC3=CC=C(C=C3)C(=O)OC[C@@H]4[C@H]([C@@H]([C@H]([C@H](O4)OC5=CC=C(C=C5)C(=O)O1)OC(=O)C6=CC=CC=C6)O)O[C@@H]7[C@@H]([C@H]([C@H]([C@@H](O7)CO)O)O)O)OC(=O)C8=CC=CC=C8)O)O[C@@H]9[C@@H]([C@H]([C@H]([C@@H](O9)CO)O)O)O |
InChI | InChI=1S/C52H56O26/c53-19-29-33(55)35(57)37(59)49(71-29)77-41-31-21-67-45(63)26-13-17-28(18-14-26)70-52-44(76-48(66)24-9-5-2-6-10-24)40(62)42(78-50-38(60)36(58)34(56)30(20-54)72-50)32(74-52)22-68-46(64)25-11-15-27(16-12-25)69-51(73-31)43(39(41)61)75-47(65)23-7-3-1-4-8-23/h1-18,29-44,49-62H,19-22H2/t29-,30-,31+,32+,33-,34-,35-,36-,37+,38+,39-,40+,41+,42-,43+,44-,49+,50+,51-,52-/m0/s1 |
InChI Key | SFSKZGVXVQCIFB-FQXOVVEFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H56O26 |
Molecular Weight | 1097.00 g/mol |
Exact Mass | 1096.30598189 g/mol |
Topological Polar Surface Area (TPSA) | 381.00 Ų |
XlogP | 0.30 |
There are no found synonyms. |
![2D Structure of [(3R,4R,5S,6S,7R,16R,17S,18R,19R,20R)-17-benzoyloxy-5,18-dihydroxy-10,23-dioxo-6,19-bis[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-2,9,15,22,29,32-hexaoxapentacyclo[22.2.2.211,14.13,7.116,20]dotriaconta-1(27),11,13,24(28),25,30-hexaen-4-yl] benzoate 2D Structure of [(3R,4R,5S,6S,7R,16R,17S,18R,19R,20R)-17-benzoyloxy-5,18-dihydroxy-10,23-dioxo-6,19-bis[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-2,9,15,22,29,32-hexaoxapentacyclo[22.2.2.211,14.13,7.116,20]dotriaconta-1(27),11,13,24(28),25,30-hexaen-4-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/a00fcea0-8627-11ee-bc11-bbb941846bef.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.00% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.21% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.42% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.12% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.84% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.35% | 86.92% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 85.48% | 87.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.30% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.04% | 89.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.23% | 95.83% |
CHEMBL209 | P07477 | Trypsin I | 83.99% | 90.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.57% | 83.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.14% | 90.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.93% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.05% | 95.56% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 81.55% | 81.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.50% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Berchemia pakistanica |
PubChem | 101725856 |
LOTUS | LTS0081847 |
wikiData | Q105252014 |