a-D-Sorf2P6P
| Internal ID | 592aecda-ce70-4459-b1de-97a7fb93a1d9 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides > Pentoses > Pentose phosphates |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dihydroxy-2-(hydroxymethyl)-5-(phosphonooxymethyl)oxolan-2-yl] dihydrogen phosphate |
| SMILES (Canonical) | C(C1C(C(C(O1)(CO)OP(=O)(O)O)O)O)OP(=O)(O)O |
| SMILES (Isomeric) | C([C@@H]1[C@@H]([C@H]([C@@](O1)(CO)OP(=O)(O)O)O)O)OP(=O)(O)O |
| InChI | InChI=1S/C6H14O12P2/c7-2-6(18-20(13,14)15)5(9)4(8)3(17-6)1-16-19(10,11)12/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4+,5-,6-/m1/s1 |
| InChI Key | YXWOAJXNVLXPMU-JGWLITMVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C6H14O12P2 |
| Molecular Weight | 340.12 g/mol |
| Exact Mass | 339.99604987 g/mol |
| Topological Polar Surface Area (TPSA) | 203.00 Ų |
| XlogP | -5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 95.36% | 94.01% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.59% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.31% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.08% | 97.29% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.55% | 97.25% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.54% | 95.93% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.98% | 96.61% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.36% | 94.73% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.32% | 91.71% |
| CHEMBL5957 | P21589 | 5'-nucleotidase | 84.28% | 97.78% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.75% | 86.92% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 80.86% | 80.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 162979383 |
| LOTUS | LTS0162627 |
| wikiData | Q105368251 |