(9Z,14Z)-1-piperidin-1-yloctadeca-9,14-dien-12-yn-1-one
| Internal ID | 3cc9083a-ba14-4a0b-acf8-b251639f0721 |
| Taxonomy | Organoheterocyclic compounds > Piperidines > N-acylpiperidines |
| IUPAC Name | (9Z,14Z)-1-piperidin-1-yloctadeca-9,14-dien-12-yn-1-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C23H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-23(25)24-21-18-16-19-22-24/h4-5,9-10H,2-3,8,11-22H2,1H3/b5-4-,10-9- |
| InChI Key | CFGHPUTWXQFCJW-ACHWKMRWSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.287514804 g/mol |
| Topological Polar Surface Area (TPSA) | 20.30 Ų |
| XlogP | 6.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.39% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.74% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.40% | 89.63% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.51% | 99.17% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 91.79% | 91.81% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 89.05% | 96.25% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.13% | 92.86% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.04% | 86.33% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.43% | 95.17% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.33% | 97.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.04% | 90.24% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.34% | 94.66% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.26% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 82.83% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.60% | 90.71% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.56% | 93.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.48% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.40% | 94.33% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 81.68% | 93.90% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.99% | 94.45% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.87% | 82.38% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.54% | 92.50% |
| CHEMBL5028 | O14672 | ADAM10 | 80.39% | 97.50% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.20% | 97.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.18% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea lycaonica |
| PubChem | 13846789 |
| LOTUS | LTS0239822 |
| wikiData | Q104956510 |