(9Z,12Z)-N-(3-Methoxybenzyl)octadeca-9,12-dienamide
| Internal ID | 273b1e5c-f435-4c9b-9a58-c828ca8c7838 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (9Z,12Z)-N-[(3-methoxyphenyl)methyl]octadeca-9,12-dienamide |
| SMILES (Canonical) | CCCCCC=CCC=CCCCCCCCC(=O)NCC1=CC(=CC=C1)OC |
| SMILES (Isomeric) | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NCC1=CC(=CC=C1)OC |
| InChI | InChI=1S/C26H41NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-26(28)27-23-24-19-18-20-25(22-24)29-2/h7-8,10-11,18-20,22H,3-6,9,12-17,21,23H2,1-2H3,(H,27,28)/b8-7-,11-10- |
| InChI Key | BMQBTHWVNBJSPS-NQLNTKRDSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.313729551 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 7.80 |
| Macamide Impurity 10 |
| N-(3-METHOXYBENZYL-(9Z,12Z)-OCTADECADIENAMIDE |
| N-(3-Methoxy)Benzyllinoleamide |
| (9Z,12Z)-N-(3-Methoxybenzyl)octadeca-9,12-dienamide |
| CHEMBL2413160 |
| (9Z,12Z)-N-[(3-methoxyphenyl)methyl]octadeca-9,12-dienamide |
| N-3-methoxybenzyl-linoleamide |
| SCHEMBL20598982 |
| BMQBTHWVNBJSPS-NQLNTKRDSA-N |
| DTXSID601187441 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.47% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.37% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 98.82% | 92.08% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.72% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.60% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.73% | 98.75% |
| CHEMBL240 | Q12809 | HERG | 92.70% | 89.76% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.20% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.03% | 94.73% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 91.45% | 95.55% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.52% | 97.29% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 87.94% | 90.75% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 87.85% | 97.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 87.61% | 96.67% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.31% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.89% | 94.45% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.86% | 95.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.21% | 96.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.16% | 86.33% |
| CHEMBL3891 | P07384 | Calpain 1 | 83.16% | 93.04% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.03% | 94.80% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.53% | 89.33% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.75% | 93.81% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 81.52% | 90.24% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.18% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lepidium meyenii |
| PubChem | 73346043 |
| LOTUS | LTS0154150 |
| wikiData | Q105100874 |