(8R,9Z,12Z)-8-Hydroperoxy-9,12-octadecadienoic acid
| Internal ID | 6995d9a7-6f3d-44dc-88b5-1456c4f8a0a4 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Lineolic acids and derivatives |
| IUPAC Name | (8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-5-6-7-8-11-14-17(22-21)15-12-9-10-13-16-18(19)20/h6-7,11,14,17,21H,2-5,8-10,12-13,15-16H2,1H3,(H,19,20)/b7-6-,14-11-/t17-/m0/s1 |
| InChI Key | RGJSGXNKRWWCOQ-QMEIEYGNSA-N |
| Popularity | 19 references in papers |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.23005950 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 5.10 |
| 8-Hydroperoxylinoleic acid |
| 143343-95-7 |
| (9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoic acid |
| (8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoic acid |
| 8R-HpODE |
| 8-Hpode |
| 8R-hydroperoxy-9Z,12Z-octadecadienoic acid |
| (8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate |
| 8r-hydroperoxylinoleic acid |
| 8(R)-Hydroperoxylinoleic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.00% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.03% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.56% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.34% | 92.08% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.54% | 89.63% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.32% | 85.94% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.20% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 92.15% | 93.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 90.39% | 97.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 87.10% | 97.29% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.44% | 91.81% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.99% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.65% | 96.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.23% | 96.00% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.54% | 96.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.40% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.06% | 100.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.82% | 93.31% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 81.24% | 92.26% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.38% | 92.32% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 80.26% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6438758 |
| LOTUS | LTS0074178 |
| wikiData | Q27116103 |