(9Z)-N-[(3-Methoxyphenyl)methyl]-9-octadecenamide
| Internal ID | f2cb22b0-76d6-451d-a4f3-a06ceb7bd0f4 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | (Z)-N-[(3-methoxyphenyl)methyl]octadec-9-enamide |
| SMILES (Canonical) | CCCCCCCCC=CCCCCCCCC(=O)NCC1=CC(=CC=C1)OC |
| SMILES (Isomeric) | CCCCCCCC/C=C\CCCCCCCC(=O)NCC1=CC(=CC=C1)OC |
| InChI | InChI=1S/C26H43NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-26(28)27-23-24-19-18-20-25(22-24)29-2/h10-11,18-20,22H,3-9,12-17,21,23H2,1-2H3,(H,27,28)/b11-10- |
| InChI Key | ZMKZIKHBSPDWEF-KHPPLWFESA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.329379614 g/mol |
| Topological Polar Surface Area (TPSA) | 38.30 Ų |
| XlogP | 8.50 |
| 883715-21-7 |
| (9Z)-N-[(3-Methoxyphenyl)methyl]-9-octadecenamide |
| CHEMBL2415105 |
| N-(3-Methoxybenzyl)oleamide |
| SCHEMBL22558561 |
| HY-N6923 |
| BDBM50438780 |
| AKOS037515000 |
| AC-35161 |
| MS-26841 |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of (9Z)-N-[(3-Methoxyphenyl)methyl]-9-octadecenamide](https://plantaedb.com/storage/docs/compounds/2023/11/9z-n-3-methoxyphenylmethyl-9-octadecenamide.jpg "2D Structure of (9Z)-N-[(3-Methoxyphenyl)methyl]-9-octadecenamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.36% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 99.35% | 99.17% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 98.77% | 92.08% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.74% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.73% | 96.09% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 93.26% | 95.55% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.21% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.34% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.01% | 90.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.40% | 97.29% |
| CHEMBL240 | Q12809 | HERG | 89.22% | 89.76% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.08% | 94.45% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 88.62% | 96.67% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 88.15% | 97.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.30% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.12% | 96.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.49% | 96.95% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 84.37% | 89.33% |
| CHEMBL3891 | P07384 | Calpain 1 | 82.31% | 93.04% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.00% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.18% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lepidium meyenii |
| PubChem | 73346080 |
| LOTUS | LTS0103928 |
| wikiData | Q105379500 |