(9S,9aS)-3,5,5,9-tetramethyl-1,6,7,8,9,9a-hexahydrobenzo[7]annulene
Internal ID | 06c5fd8f-fb99-4731-b4ef-b5f99aedb8ca |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Himachalane and lippifoliane sesquiterpenoids |
IUPAC Name | (9S,9aS)-3,5,5,9-tetramethyl-1,6,7,8,9,9a-hexahydrobenzo[7]annulene |
SMILES (Canonical) | CC1CCCC(C2=CC(=CCC12)C)(C)C |
SMILES (Isomeric) | C[C@H]1CCCC(C2=CC(=CC[C@@H]12)C)(C)C |
InChI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h7,10,12-13H,5-6,8-9H2,1-4H3/t12-,13-/m0/s1 |
InChI Key | JMGZKUMTFGHNRS-STQMWFEESA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24 |
Molecular Weight | 204.35 g/mol |
Exact Mass | 204.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.86% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.97% | 97.25% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 92.88% | 86.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.61% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.67% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.45% | 94.80% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.09% | 93.99% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.71% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.89% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.83% | 94.75% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.61% | 96.43% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 82.22% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abies alba |
PubChem | 14038470 |
LOTUS | LTS0017964 |
wikiData | Q105131401 |