(9S,10E,16Z)-9-acetyloxyoctadeca-10,16-dien-12,14-diynoic acid
| Internal ID | 53cdbc7a-19f4-4301-a48b-6e3567c44826 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | (9S,10E,16Z)-9-acetyloxyoctadeca-10,16-dien-12,14-diynoic acid |
| SMILES (Canonical) | CC=CC#CC#CC=CC(CCCCCCCC(=O)O)OC(=O)C |
| SMILES (Isomeric) | C/C=C\C#CC#C/C=C/[C@H](CCCCCCCC(=O)O)OC(=O)C |
| InChI | InChI=1S/C20H26O4/c1-3-4-5-6-7-9-12-15-19(24-18(2)21)16-13-10-8-11-14-17-20(22)23/h3-4,12,15,19H,8,10-11,13-14,16-17H2,1-2H3,(H,22,23)/b4-3-,15-12+/t19-/m1/s1 |
| InChI Key | VJUOUHHKMMAOMR-BUVDJEAVSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.23% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.85% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.12% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.57% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.83% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.38% | 83.82% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.30% | 97.21% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.53% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.16% | 93.56% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.83% | 95.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.73% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.50% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Inulanthera dregeana |
| Inulanthera tridens |
| PubChem | 163003993 |
| LOTUS | LTS0070818 |
| wikiData | Q105287520 |