(9S)-9-methyl-2-methylidene-3-prop-1-en-2-yl-6,7,8,9-tetrahydro-1-benzoxepin-5-one
Internal ID | 65347dda-0fd9-48e0-9c63-984c973b726a |
Taxonomy | Organic acids and derivatives > Vinylogous esters |
IUPAC Name | (9S)-9-methyl-2-methylidene-3-prop-1-en-2-yl-6,7,8,9-tetrahydro-1-benzoxepin-5-one |
SMILES (Canonical) | CC1CCCC2=C1OC(=C)C(=CC2=O)C(=C)C |
SMILES (Isomeric) | C[C@H]1CCCC2=C1OC(=C)C(=CC2=O)C(=C)C |
InChI | InChI=1S/C15H18O2/c1-9(2)13-8-14(16)12-7-5-6-10(3)15(12)17-11(13)4/h8,10H,1,4-7H2,2-3H3/t10-/m0/s1 |
InChI Key | LIKVZNBOYGRKRL-JTQLQIEISA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H18O2 |
Molecular Weight | 230.30 g/mol |
Exact Mass | 230.130679813 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.79% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.79% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.95% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.62% | 91.49% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.17% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.79% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.36% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.93% | 89.00% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.34% | 93.04% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.68% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.11% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cineraria aspera |
Cineraria grandibracteata |
Cineraria parvifolia |
PubChem | 101324804 |
LOTUS | LTS0023689 |
wikiData | Q104395117 |